Banner
targets (4)
for drugs
Identification
Name Menthol
Accession Number DB00825 (APRD01604)
Type small molecule
Groups approved
Description

Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. It is a waxy, crystalline substance, clear or white in color, which is solid at room temperature and melts slightly above. The main form of menthol occurring in nature is (-)-menthol, which is assigned the (1R,2S,5R) configuration. Menthol has local anesthetic and counterirritant qualities, and it is widely used to relieve minor throat irritation.

Structure Thumb
Download: MOL | SDF | SMILES | InChI
Display: 2D Structure | 3D Structure
Synonyms
(-)-menthol
(r)-(-)-menthol
L-(-)-menthol
L-menthol
Levomenthol
Salts Not Available
Brand names Not Available
Brand mixtures
Brand Name Ingredients
A.P.R 15 lidocaine hydrochloride + menthol
Absorbine analgesic creme camphor + eucalyptus oil + menthol + methyl salicylate
Absorbine arthritis strength liquid capsicum + menthol
Absorbine JR antifungal liq menthol + tolnaftate
Absorbine JR extra strength liniment chloroxylenol + menthol
Absorbine junior patch camphor + eucalyptus oil + menthol
Absorbine power gel chloroxylenol + menthol
Acti bleu lotion camphor + menthol + methyl salicylate
Acti poultice eucalyptus oil + magnesium sulfate + menthol + methyl salicylate + thymol
Acti vapo camphor + eucalyptus oil + menthol
Adult formula belladonna + bryonia + drosera rotundifolia + ipecac + menthol + oil of turpentine + peppermint + spongia tosta + sticta pulmonaria + wild thyme
Amber mouthwash - liq eucalyptol + menthol + thymol
Amol cinnamon oil + clove oil + lavender oil + menthol + myristica oil + oil of citronella + oil of lemon + peppermint oil
Analgesic sport stick menthol + methyl salicylate
Anbesol liquid benzocaine + camphor + menthol + phenol
Anifen cough DPS fennel oil + menthol + oil of anise
Antiseptic mouth rinse - liq eucalyptol + menthol + thymol
Antiseptic mouthwash cool mint eucalyptol + menthol + thymol
Antiseptic mouthwash mint eucalyptol + menthol + thymol
Arthricare for women nighttime menthol + methyl nicotinate + methyl salicylate
Arthricare for women ultra strength capsaicin (capsicum oleoresin) + menthol
Arthriflex eucalyptol + menthol
Arthritis pain reliever herbalife camphor + menthol + methyl salicylate
Arthro rheuma cream camphor + menthol
Arthrocare lotion camphor + eucalyptus oil + histamine dihydrochloride + menthol + methyl salicylate
Artrikor creme analgesique camphor + capsaicin + eucalyptus oil + menthol
Artritol creme rubefiante menthol + methyl salicylate
Avon healthy remedies menthol & camphor soothing relief gel camphor + menthol
Balminil camphorub camphor + eucalyptol + menthol
Balminil nasal ointment camphor + chlorobutanol + ephedrine hydrochloride + eucalyptol + l-menthol
Banana boat sooth-a-caine spray gel lidocaine + menthol
Baumodyne gel menthol + methyl salicylate
Beech nut black cough drop menthol + oil of anise
Beech nut black cough drops menthol + oil of anise
Beech nut honey lemon cough drop eucalyptus oil + menthol
Beech nut honey lemon cough drops eucalyptus + menthol
Beech nut menthol cough drop anethole + eucalyptus oil + menthol
Beech nut wild cherry cough DPS eucalyptus oil + menthol
Beech nut wild cherry cough drop eucalyptus oil + menthol
Beech nut wild cherry cough drops eucalyptus oil + menthol
Beech-nut menthol cough drops anethole + eucalyptus oil + menthol
Ben-gay arthritis pain rub ont menthol + methyl salicylate
Ben-gay ultra strength pain relieving rub camphor + menthol + methyl salicylate
Bengay arthritis extra strength menthol + methyl salicylate
Bengay muscle pain regular strength menthol + methyl salicylate
Bengay muscle pain ultra strength camphor + menthol + methyl salicylate
Bentasil cherry anethole + menthol
Bentasil extra strength eucalyptus eucalyptus oil + menthol
Bentasil extra strength menthol eucalyptus oil + menthol
Bentasil green anethole + eucalyptol + menthol
Bentasil honey-lemon anethole + menthol
Bentasil red anethole + menthol
Bentasil yellow anethole + menthol
Benylin DM-d-e extra strength with menthactin dextromethorphan hydrobromide + guaifenesin + menthol + pseudoephedrine hydrochloride
Benylin DM-e extra strength with menthactin dextromethorphan hydrobromide + guaifenesin + menthol
Benylin e extra strength with menthactin guaifenesin + menthol
Benylin first defense cough lozenges echinacea (echinacea angustifolia, echinacea purpurea) + menthol (peppermint oil)
Benylin first defense herbal syrup echinacea (echinacea angustifolia) + menthol (peppermint oil)
Bigeloil alcohol anhydrous + menthol + methyl salicylate + salicylic acid + thymol
Bigeloil liquid gel alcohol anhydrous + menthol + methyl salicylate + thymol
Biofreeze camphor + menthol
Bite relief benzocaine + camphor + menthol + phenol
Braceoil alcohol anhydrous + camphor + menthol + methyl salicylate + salicylic acid + thymol
Bronchex cough syrup ammonia + ammonium carbonate + ammonium chloride + glycerine + glycyrrhiza glabra + menthol + oil of fir + white pine
Bronchilon cough pastilles eucalyptus + menthol
Broncho rub camphor + menthol + oil of cajeput + turpentine
Bronchodex vapo ont camphor + eucalyptus oil + menthol
Bronchodex-rub camphor + eucalyptus oil + menthol + methyl salicylate
Bronchyl SYR alcohol anhydrous + beechwood creosote + cocillana + eucalyptus + guaiacol oleate + ipecac + lobelia inflata + menthol + myroxylon balsamum + theophylline + white pine
Buckley's bedtime diphenhydramine hydrochloride + menthol
Buckley's complete acetaminophen + menthol
Buckley's mixture ammonium carbonate + camphor + menthol + potassium bicarbonate
Buckley's pain relief rub menthol + methyl salicylate
Buckley's white rub camphor + menthol + methyl salicylate + thymol
Cal mo dol ont camphor + eucalyptol + menthol + methyl salicylate + oil of turpentine + peppermint oil
Calmitol itching relief ont camphor + chloral hydrate + hyoscyamine + menthol + zinc oxide
Campho rex camphor + menthol
Camphorated ointment compound camphor + eucalyptol + menthol
Camphro septhal ont camphor + eucalyptus + menthol + methyl salicylate
Carboseptol eucalyptol + menthol + methyl salicylate + thymol + zinc oxide
Chapstick medicated lip balm - STK camphor + menthol + petrolatum + phenol
Chapstick medicated lip balm - tube camphor + menthol + petrolatum + phenol
Chase coldsorex benzoin + camphor + menthol + MYRRH
Chest rub ont camphor + eucalyptus oil + menthol
Chloraseptic sore throat lozenges - cherry benzocaine + menthol
Chloraseptic sore throat lozenges - menthol benzocaine + menthol
Chloraseptic sore throat relief strips benzocaine + menthol
Choates veterinary horse liniment camphor + capsicum + menthol
Cold sore lotion benzoin + camphor + menthol
Cool mint antiseptic mouthwash eucalyptol + menthol + thymol
Coolmint antiseptic mouthwash eucalyptol + menthol + thymol
Cou formula belladonna + bryonia + drosera rotundifolia + ipecac + menthol + spongia tosta + sticta pulmonaria + wild thyme
Cuticura medicated body powder menthol + zinc oxide
Deep heating ultra strength rub CRM menthol + methyl salicylate
Denorex medicated shampoo - regular chloroxylenol + coal tar + menthol
Denorex medicated shampoo spring fresh chloroxylenol + coal tar + menthol
Dentalgar liq benzocaine + camphor + clove oil + guaiacol + menthol
Dermarest plus - gel diphenhydramine hydrochloride + menthol
Dermoplast benzocaine + menthol
Dermoplast aerosol spray benzethonium chloride + benzocaine + menthol + oxyquinoline benzoate
DR. C's itch not lotion camphor + menthol
DR.'s cream capsaicin + menthol + methyl salicylate
Eagle brand medicated oil eucalyptus oil + menthol + methyl salicylate
Em eukal cough DPS eucalyptus oil + menthol
Eucamenth eucalyptus oil + menthol + oil of camphor
Expectorine ammonium chloride + eucalyptus oil + menthol
Extra strength gold bond menthol + zinc oxide
Flex-o-flex capsaicin + menthol
Flex-o-flex extra-fort capsaicin + menthol
Flex-o-flex kamu camphor + menthol
Flexall stick menthol + menthyl salicylate
Flexogan arthritis pain camphor + menthol + methyl salicylate
Flexogan muscle pain camphor + menthol
Flexogan sport camphor + menthol
Flexogan sport ultra camphor + menthol + methyl salicylate
Formula t.t. cold sore cream camphor + menthol + phenol
Formule 12 eucalyptol + menthol
Forshner's blue lotion camphor + eucalyptus oil + menthol + methyl salicylate
Freeze liq camphor + ethyl ether + glycerine + isopropyl alcohol + menthol
Fresh taste antiseptic mouthwash eucalyptol + menthol + thymol
Gold bond menthol + zinc oxide
Gold bond extra strength medicated body lotion dimethicone + menthol
Gold bond medicated body powder menthol + zinc oxide
Gold bond medicated cream 28G menthol + pramoxine hydrochloride
Gold bond medicated lotion regular strength) (dimethicone + menthol
Gouttes dentaires benzocaine + camphor + clove oil + guaiacol + menthol
Halls blueberry eucalyptus oil + menthol
Halls centres cherry lozenges eucalyptus oil + menthol
Halls centres honey lemon eucalyptus oil + menthol
Halls centres honey-lemon loz eucalyptus oil + menthol
Halls centres regular eucalyptus oil + menthol
Halls extra strong eucalyptus oil + menthol
Halls extra strong mentho-lyptus cough tab eucalyptus oil + menthol
Halls extra strong mentho-lyptus cough tablets eucalyptus oil + menthol
Halls lemon-lime eucalyptus oil + menthol
Halls mentho lyptus cough tab eucalyptus oil + menthol
Halls mentho lyptus cough tab black currant eucalyptus oil + menthol
Halls mentho lyptus cough tab cherry eucalyptus oil + menthol
Halls mentho lyptus cough tab honey lemon eucalyptus oil + menthol
Halls mentho lyptus tab coolmint eucalyptus oil + menthol
Halls mentho-lyptus cough tablets black cherry eucalyptus oil + menthol
Halls mentho-lyptus cough tablets black currant eucalyptus oil + menthol
Halls mentho-lyptus cough tablets cherry eucalyptus oil + menthol
Halls mentho-lyptus cough tablets cool mint eucalyptus oil + menthol
Halls mentho-lyptus cough tablets honey lemon eucalyptus oil + menthol
Halls mentho-lyptus cough tablets mountain menthol eucalyptus oil + menthol
Halls mentho-lyptus cough tablets orange eucalyptus oil + menthol
Halls mentho-lyptus cough tablets regular eucalyptus oil + menthol
Halls mentho-lyptus cough tablets strawberry eucalyptus oil + menthol
Heat rub camphor + eucalyptus oil + menthol + methyl salicylate
Herbal medicated lozenge echinacea angustifolia + echinacea purpurea + menthol
Herbal throat lozenges camphor + elm bark + horehound + menthol + parsley + thyme
Herbon cough drops adventurous tingle with a hint of orange flavour echinacea (echinacea angustifolia, echinacea purpurea) + glycyrrhiza glabra + menthol
Herbon cough drops glacial mint chamomile + echinacea (echinacea angustifolia, echinacea purpurea) + eucalyptus oil + fritillaria cirrhosa + horehound + menthol + salvia + thyme
Herbon lemon honey flavour herbal throat drops echinacea (echinacea angustifolia, echinacea purpurea) + menthol
Herbon wild cherry flavour throat drops echinacea (echinacea angustifolia, echinacea purpurea) + glycyrrhiza glabra + lime tree flower + menthol + sambucus nigra + wild cherry
Honey lemon menthol eucalyptus cough DPS eucalyptus oil + menthol
Infraline liq eucalyptol + menthol + methyl salicylate
Inno rheuma massage oil lavender oil + menthol + rosemary oil
Instant rub ointment menthol + methyl salicylate
Itch nix camphor + menthol
Kama sutra pleasure balm benzocaine + camphor + menthol
Kiro rub menthol + methyl salicylate
Kiro rub ont camphor + eucalyptus oil + menthol + methyl salicylate
Kiro-rub eucalyptol + menthol + methyl salicylate
Kiroflex camphor + eucalyptus oil + menthol + thymol
Kobi - CRM menthol + methyl salicylate
Koffex DM-d-e - liq dextromethorphan hydrobromide + guaifenesin + pseudoephedrine hydrochloride
Kwan loong oil eucalyptus oil + menthol + methyl salicylate
Kwan tak hing plaster - pad-PLS borneol + menthol
Lakota topical pain reliever capsaicin + menthol
Lakota topical pain reliever - extra strength capsaicin + menthol
Lamberts SYR menthol + pine tar
Leg paint & sweat glycerine + iodine + isopropyl alcohol + menthol + phenol + potassium iodide
Leg solution iodine + menthol + methyl salicylate + potassium iodide + thymol
Lin o gel camphor + clove oil + iodine + isopropyl alcohol + menthol + thymol + turpentine
Lip conditioner lip balm camphor + menthol + meradimate + padimate o + phenol
Lip medex camphor + menthol + phenol
Lipsorex benzethonium chloride + menthol + thymol
Lipsorex - gel benzethonium chloride + menthol + thymol
Lipsorex plus benzethonium chloride + lidocaine + menthol + thymol
Lipsorex-gel benzethonium chloride + menthol + thymol
Listerine antiseptic mouthwash eucalyptol + menthol + thymol
Listerine antiseptic mouthwash with fluoride eucalyptol + menthol + sodium fluoride + thymol
Listerine antiseptic tartar control mouthwash eucalyptol + menthol + thymol + zinc chloride
Lofthouse origin ext-strong fisherman friend eucalyptus oil + menthol
Lotion bleu camphor + menthol + methyl salicylate
Lotion pour feux sauvages benzoin + camphor + menthol + MYRRH
MÉdi-rub eucalyptus oil + menthol + methyl salicylate
Marathon deep heat rub menthol + methyl salicylate
Marco rub camphorated ont camphor + eucalyptol + menthol
Medi-kool pak aluminum sulfate + arnica + boric acid + calcium acetate + camphor + menthol + methyl salicylate + tannic acid
Medi-kool titener arnica + camphor + menthol + methyl salicylate + tannic acid
Medicated body powder menthol + zinc oxide
Medicated chest rub camphor + eucalyptus oil + menthol
Medicated chest rub - ont camphor + eucalyptus oil + menthol
Medicated chest rub - ont top camphor + eucalyptus oil + menthol
Medicated ointment camphor + eucalyptus oil + menthol
Medicated vapourizer fluid camphor + eucalyptus oil + menthol
Medimentol ont camphor + eucalyptus oil + menthol + oil of camphor + oil of fir + turpentine
Menthacin - cream capsaicin + menthol
Menthacin cream capsaicin + menthol
Menthacin lotion capsaicin + menthol
Mentholatum cough drops eucalyptus oil + menthol
Mentholatum deep heating lot menthol + methyl salicylate
Mentholatum deep heating rub menthol + methyl salicylate
Mentholatum extra strength ont camphor + eucalyptus oil + menthol
Mentholatum ont camphor + menthol
Minard's joint relief menthol + methyl salicylate
Multi rub eucalyptol + menthol + methyl salicylate
Multi-freeze ont camphor + isopropyl alcohol + menthol
Muscle liniment camphor + isopropyl alcohol + menthol + oil of dwarf pine needles
Muscle mist clove oil + menthol
Myoflex extra strength ice menthol + trolamine salicylate
Myoflex ice cold plus - gel menthol + trolamine salicylate
Myoflex ice plus - CRM menthol + trolamine salicylate
Natur 911 camphor + eucalyptus oil + menthol + phenol + thymol
Naturland sports cream camphor + menthol
Nose head clear camphor + eucalyptus oil + menthol
Obus form therapeutic heat rub menthol + methyl salicylate
Onguent camphre menthol alsi camphor + eucalyptol + menthol
Onguent vaporisant camphor + eucalyptus oil + menthol
Orajel denture plus benzocaine + menthol
Orajel multi-action cold sore medicine allantoin + benzocaine + camphor + dimethicone + menthol + white petrolatum
Orajel ultra canker sore medicine benzocaine + menthol
Original antiseptic mouthwash eucalyptol + menthol + thymol
Orthorub eucalyptol + menthol + methyl salicylate
Pain buster 2000 camphor + eucalyptus oil + menthol + methyl salicylate
Pain relieving ointment camphor + cinnamon oil + clove oil + mentha arvensis + menthol + oil of cajeput
Pain relieving salonpas patch camphor + l-menthol + methyl salicylate
Pain-a-trate cream camphor + menthol + methyl salicylate
Pastilles valda eucalyptol + guaiacol + menthol + terpin hydrate + thymol
Penetrating rub ont eucalyptus oil + menthol + methyl salicylate + oil of cajeput + oil of mustard expressed
Physio-rub eucalyptol + menthol + methyl salicylate
Physiorub plus eucalyptol + menthol + methyl salicylate
Phytorub ont eucalyptol + menthol + methyl salicylate
Polar ice paste camphor + isopropyl alcohol + menthol
Pommade au the des bois camphor + eucalyptol + menthol + methyl salicylate
Poudre menthol + zinc oxide
Pramegel 1% menthol + pramoxine hydrochloride
Prosync muscle rub menthol + methyl salicylate
Pulmoll menthol - eucalyptol pastilles eucalyptus oil + menthol + peppermint oil
Pulmoll pastilles glycyrrhizin + menthol
Pulmosirum decongestionnant sirop beechwood creosote + cocillana + eucalyptus + guaiacol + ipecac + lobelia inflata + menthol + myroxylon balsamum + pseudoephedrine hydrochloride + white pine
Pulmosirum plus expectorant ammonium chloride + beechwood creosote + cocillana + eucalyptus oil + guaiacol + guaifenesin + ipecac + lobelia inflata + menthol + myroxylon balsamum + white pine
R76 aconite + ammi visnaga + convallaria majalis + drosera rotundifolia + lobelia inflata + menthol + potassium iodide + stramonium
Rheila medicated cough DPS glycyrrhiza glabra + menthol
Rheumalan ont belladonna + camphor + capsicum oleoresin + croton oil + eucalyptus oil + menthol + methyl salicylate + oil of mustard expressed + salicylic acid
Rhino-vaccin camphor + chlorobutanol + eucalyptol + l-ephedrine hydrochloride + menthol
Rub a 535 ancient secret - natural source camphor (cinnamomum camphora) + eucalyptus oil (eucalyptus globulus, eucalyptus fructicetorum, eucalyptus smithII) + menthol (peppermint) + methyl salicylate (wintergreen leaf)
Rub a 535 dual action camphor + eucalyptus oil + menthol + methyl salicylate
Salonpas - PLS top camphor + glycol salicylate + l-menthol + methyl salicylate + thymol
Salonpas gel-patch camphor + glycol salicylate + l-menthol
Savex with sunscreen ont camphor + menthol + salicylic acid
Scalpicin menthol + salicylic acid
Scarlet oil pump spray eucalyptus oil + menthol + oil of camphor + oil of thyme + peruvian balsam + phenol + pine oil
Solucodan syrup hydrocodone bitartrate + menthol + potassium guaiacol sulphonate + sodium citrate
Solucodan-h diphenylpyraline hydrochloride + hydrocodone bitartrate + menthol + potassium guaiacol sulphonate + sodium citrate
Sore throat lozenges menthol flavour benzocaine + menthol
Sore throat lozenges with benzocaine and menthol benzocaine + menthol
Star-vi-dol ammonium chloride + eucalyptol + menthol + myroxylon balsamum + white pine + wild cherry
Strepsils cherry amylmetacresol + dichlorobenzyl alcohol + menthol
Sucrets cherry vapour action loz hexylresorcinol + menthol
Tensol iodine + menthol + potassium iodide
Thera patch camphor + menthol + methyl salicylate
Therapatch vapor - chest camphor + eucalyptus oil + menthol
Therapatch vapour - nose & chin camphor + eucalyptus oil + menthol
Thermo-gel benzocaine + camphor + menthol + thymol
Thuna balsam salve ont eucalyptus oil + menthol + methyl salicylate
Thunas salve for rheumatic pains camphor + menthol + methyl salicylate
Tiger balm arthritis rub camphor + clove oil + dementholised mint oil + menthol + oil of cajeput
Tiger balm liniment eucalyptus oil + menthol + methyl salicylate
Tiger balm patch warm camphor + capsaicin + dementholised mint oil + eucalyptus oil + menthol
Tiger balm red extra strength camphor + cinnamon oil + clove oil + menthol + oil of cajeput + peppermint oil
Tiger balm red strong camphor + cinnamon oil + clove oil + menthol + oil of cajeput + peppermint oil
Tiger balm ultra camphor + cinnamon oil + clove oil + menthol + oil of cajeput + peppermint oil
Tiger balm white extra strength camphor + clove oil + menthol + oil of cajeput + peppermint oil
Tiger balm white regular camphor + clove oil + menthol + oil of cajeput + peppermint oil
Tobtox benzene + cactus grandiflorus + coffea tosta + daphne indica + delphinium staphisagria + eucalyptus + lobelia inflata + lycopodium clavatum + menthol + naphthalene + nitric acid + oats + phosphorus + potassium phosphate dibasic + tobacco
Trialine menthol + methyl salicylate
Triaminic vapour patch camphor + eucalyptus oil + menthol
Valda pastilles eucalyptol + guaiacol + menthol + terpin hydrate + thymol
Valda pastilles lemon flavoured eucalyptol + guaiacol + menthol + terpin hydrate + thymol
Vaporisateur medicamente camphor + eucalyptol + menthol + thymol
Vaporisateur medicamente aero camphor + eucalyptus oil + menthol + thymol
Vaporizing colds rub - ont camphor + eucalyptus oil + menthol
Vapourizing colds rub camphor + eucalyptus oil + menthol
Vicks inhaler camphor + menthol
Vicks vapo steam medication camphor + eucalyptus oil + lavender oil + menthol + methyl salicylate + peppermint oil
Vicks vaporub lemon ointment camphor + eucalyptus oil + menthol
Vicks vaporub lotion camphor + eucalyptus oil + menthol
Vitarub ont eucalyptol + menthol + methyl salicylate
Watkins analgesic balm capsicum oleoresin + menthol + methyl salicylate + oil of turpentine
Watkins medicated ointment camphor + menthol
Watkins medicated ont camphor + eucalyptus oil + menthol + oil of camphor + phenol
White flower analgesic balm camphor + eucalyptus oil + menthol + methyl salicylate + peppermint oil
Wrigley's alpine eucalyptus oil + menthol
Wrigley's alpine cherry eucalyptus oil + menthol
Youngflex massage ointment 168 eucalyptus oil + menthol + oil of cajeput
Zev ammonium carbonate + buckthorn + camphor + menthol + potassium bicarbonate + squill
Zilactin-lip regular and cherry flavour) (dimethicone + homosalate + menthol + octinoxate + oxybenzone
First Prev Next Last
Categories
  • Antipruritics
CAS number 2216-51-5
Weight Average: 156.2652
Monoisotopic: 156.151415262
Chemical Formula C10H20O
InChI Key InChIKey=NOOLISFMXDJSKH-KXUCPTDWSA-N
InChI
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1
Plain Text
IUPAC Name
(1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol
SMILES
CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O
Plain Text
Mass Spec show (2.96 KB)
Taxonomy
Kingdom Organic
Classes
  • Alcohols and Polyols
Substructures
  • Hydroxy Compounds
  • Alcohols and Polyols
Pharmacology
Indication Used to treat occasional minor irritation, pain, sore mouth, and sore throat as well as cough associated with a cold or inhaled irritants.
Pharmacodynamics Menthol is a covalent organic compound made synthetically or obtained from peppermint or other mint oils. Menthol's ability to chemically trigger cold-sensitive receptors in the skin is responsible for the well known cooling sensation that it provokes when inhalated, eaten, or applied to the skin. It should be noted that menthol does not cause an actual drop in temperature.
Mechanism of action Menthol primarily activates the cold-sensitive TRPM8 receptors in the skin. Menthol, after topical application, causes a feeling of coolness due to stimulation of 'cold' receptors by inhibiting Ca++ currents of neuronal membranes. It may also yield analgesic properties via kappa-opioid receptor agonism.
Absorption Not Available
Volume of distribution Not Available
Protein binding Not Available
Metabolism Not Available
Route of elimination Not Available
Half life Not Available
Clearance Not Available
Toxicity Menthol, DL: ORAL (LD50): Acute: 2900 mg/kg [Rat], 3100 mg/kg [Mouse]. DERMAL (LD50): Acute: 5001 mg/kg [Rabbit].
Affected organisms
  • Humans and other mammals
Pathways Not Available
Pharmacoeconomics
Manufacturers Not Available
Packagers
Dosage forms
Form Route Strength
Cream Topical
Gel Topical
Liquid Nasal
Liquid Oral
Liquid Topical
Lozenge Oral
Ointment Topical
Patch Topical
Powder Topical
Solution / drops Oral
Spray Topical
First Prev Next Last
Prices
Unit description Cost Unit
Cool & heat patch 1.2 USD patch
Icy hot medicated 5% patch 1.2 USD patch
Bengay pain relieving patch 1.13 USD patch
CVS Pharmacy pain relieving patch 1.11 USD patch
Cold & hot pain rel patch 1.05 USD patch
Nuprin muscle & joint patch 1.03 USD patch
Mentholatum pain patch 0.93 USD patch
CVS Pharmacy cold & hot medicated patch 0.89 USD patch
Salonsip aqua-patch 0.69 USD patch
Menthol crystal 0.49 USD g
Menthol cough drops 0.06 USD each
CVS Pharmacy menthol drops 0.03 USD each
Pv menthol cough drops 0.02 USD each
First Prev Next Last
DrugBank does not sell nor buy drugs. Pricing information is supplied for informational purposes only.
Patents Not Available
Properties
State solid
Experimental Properties
Property Value Source
melting point 43 °C PhysProp
boiling point 212 °C PhysProp
water solubility 490 mg/L (at 25 °C) CHEM INSPECT TEST INST (1992)
logP 3.40 GRIFFIN,S ET AL. (1999)
Predicted Properties
Property Value Source
water solubility 5.58e-01 g/l ALOGPS
logP 2.68 ALOGPS
logP 2.66 ChemAxon
logS -2.5 ALOGPS
pKa (strongest acidic) 19.55 ChemAxon
pKa (strongest basic) -0.81 ChemAxon
physiological charge 0 ChemAxon
hydrogen acceptor count 1 ChemAxon
hydrogen donor count 1 ChemAxon
polar surface area 20.23 ChemAxon
rotatable bond count 1 ChemAxon
refractivity 47.45 ChemAxon
polarizability 19.69 ChemAxon
References
Synthesis Reference Not Available
General Reference Not Available
External Links
Resource Link
KEGG Drug D00064 Link_out
KEGG Compound C00400 Link_out
PubChem Compound 16666 Link_out
PubChem Substance 46506513 Link_out
ChemSpider 15803 Link_out
ChEBI 15409 Link_out
ChEMBL 15409 Link_out
Therapeutic Targets Database DAP000876 Link_out
PharmGKB PA164776605 Link_out
IUPHAR 2430 Link_out
Guide to Pharmacology 2430 Link_out
Drug Product Database 2241935 Link_out
Drugs.com http://www.drugs.com/cdi/menthol-cream.html Link_out
Wikipedia http://en.wikipedia.org/wiki/Menthol Link_out
ATC Codes
  • M02AX10
  • R02AA20
AHFS Codes
  • 48:01.00*
  • 52:92.00
  • 84:08.01*
  • 84:24.04
  • 92:02.00*
  • 84:08.00
PDB Entries Not Available
FDA label Not Available
MSDS show (73.2 KB)
Interactions
Drug Interactions Not Available
Food Interactions Not Available
Targets

1. Transient receptor potential cation channel subfamily M member 8

Pharmacological action: yes
Actions: inducer

Receptor-activated non-selective cation channel involved in detection of sensations such as coolness, by being activated by cold temperature below 25 degrees Celsius. Activated by icilin, eucalyptol, menthol, cold and modulation of intracellular pH. Involved in menthol sensation. Permeable for monovalent cations sodium, potassium, and cesium and divalent cation calcium. Temperature sensing is tightly linked to voltage-dependent gating. Activated upon depolarization, changes in temperature resulting in graded shifts of its voltage-dependent activation curves. The chemical agonists menthol functions as a gating modifier, shifting activation curves towards physiological membrane potentials. Temperature sensitivity arises from a tenfold difference in the activation energies associated with voltage-dependent opening and closing

Organism class: human
UniProt ID: Q7Z2W7 Link_out
Gene: TRPM8 Link_out
Protein Sequence: FASTA
Gene Sequence: FASTA
SNPs: SNPJam Report Link_out

References:
  1. Story GM, Peier AM, Reeve AJ, Eid SR, Mosbacher J, Hricik TR, Earley TJ, Hergarden AC, Andersson DA, Hwang SW, McIntyre P, Jegla T, Bevan S, Patapoutian A: ANKTM1, a TRP-like channel expressed in nociceptive neurons, is activated by cold temperatures. Cell. 2003 Mar 21;112(6):819-29. Pubmed
  2. Behrendt HJ, Germann T, Gillen C, Hatt H, Jostock R: Characterization of the mouse cold-menthol receptor TRPM8 and vanilloid receptor type-1 VR1 using a fluorometric imaging plate reader (FLIPR) assay. Br J Pharmacol. 2004 Feb;141(4):737-45. Epub 2004 Feb 2. Pubmed
  3. Bandell M, Story GM, Hwang SW, Viswanath V, Eid SR, Petrus MJ, Earley TJ, Patapoutian A: Noxious cold ion channel TRPA1 is activated by pungent compounds and bradykinin. Neuron. 2004 Mar 25;41(6):849-57. Pubmed
  4. Andersson DA, Chase HW, Bevan S: TRPM8 activation by menthol, icilin, and cold is differentially modulated by intracellular pH. J Neurosci. 2004 Jun 9;24(23):5364-9. Pubmed
  5. Stein RJ, Santos S, Nagatomi J, Hayashi Y, Minnery BS, Xavier M, Patel AS, Nelson JB, Futrell WJ, Yoshimura N, Chancellor MB, De Miguel F: Cool (TRPM8) and hot (TRPV1) receptors in the bladder and male genital tract. J Urol. 2004 Sep;172(3):1175-8. Pubmed
  6. Eccles R: Menthol and related cooling compounds. J Pharm Pharmacol. 1994 Aug;46(8):618-30. Pubmed
  7. Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. Pubmed

2. Transient receptor potential cation channel subfamily A member 1

Pharmacological action: yes
Actions: inducer

Receptor-activated non-selective cation channel involved in detection of sensations such as cold, pain or sounds perception. Has a central role in the pain response to endogenous inflammatory mediators and to a diverse array of volatile irritants, such as mustard oil, garlic and acrolein, an irritant from tears gas and vehicule exhaust fumes. Also involved in pain sensation triggered by capsaicin, the pungent ingredient in chilli peppers. Acts also as a ionotropic cannabinoid receptor by being activated by delta(9)-tetrahydrocannabinol (THC), the psychoactive component of marijuana. Not involved in menthol sensation. May be a component for the mechanosensitive transduction channel of hair cells in inner ear, thereby participating in the perception of sounds. Probably operated by a phosphatidylinositol second messenger system

Organism class: human
UniProt ID: O75762 Link_out
Gene: TRPA1 Link_out
Protein Sequence: FASTA
Gene Sequence: FASTA
SNPs: SNPJam Report Link_out

References:
  1. Story GM, Peier AM, Reeve AJ, Eid SR, Mosbacher J, Hricik TR, Earley TJ, Hergarden AC, Andersson DA, Hwang SW, McIntyre P, Jegla T, Bevan S, Patapoutian A: ANKTM1, a TRP-like channel expressed in nociceptive neurons, is activated by cold temperatures. Cell. 2003 Mar 21;112(6):819-29. Pubmed
  2. Namer B, Seifert F, Handwerker HO, Maihofner C: TRPA1 and TRPM8 activation in humans: effects of cinnamaldehyde and menthol. Neuroreport. 2005 Jun 21;16(9):955-9. Pubmed
  3. Macpherson LJ, Hwang SW, Miyamoto T, Dubin AE, Patapoutian A, Story GM: More than cool: promiscuous relationships of menthol and other sensory compounds. Mol Cell Neurosci. 2006 Aug;32(4):335-43. Epub 2006 Jul 7. Pubmed
  4. Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. Pubmed

3. Transient receptor potential cation channel subfamily V member 3

Pharmacological action: yes
Actions: inducer

Putative receptor-activated non-selective calcium permeant cation channel. It is activated by innocuous (warm) temperatures and shows an increased response at noxious temperatures greater than 39 degrees Celsius. Activation exhibits an outward rectification. May associate with TRPV1 and may modulate its activity

Organism class: human
UniProt ID: Q8NET8 Link_out
Gene: TRPV3
Protein Sequence: FASTA
Gene Sequence: FASTA
SNPs: SNPJam Report Link_out

References:
  1. Macpherson LJ, Hwang SW, Miyamoto T, Dubin AE, Patapoutian A, Story GM: More than cool: promiscuous relationships of menthol and other sensory compounds. Mol Cell Neurosci. 2006 Aug;32(4):335-43. Epub 2006 Jul 7. Pubmed

4. Kappa-type opioid receptor

Pharmacological action: unknown
Actions: agonist

Inhibits neurotransmitter release by reducing calcium ion currents and increasing potassium ion conductance. Receptor for dynorphins. May play a role in arousal and regulation of autonomic and neuroendocrine functions

Organism class: human
UniProt ID: P41145 Link_out
Gene: OPRK1 Link_out
Protein Sequence: FASTA
Gene Sequence: FASTA
SNPs: SNPJam Report Link_out

References:
  1. Galeotti N, Di Cesare Mannelli L, Mazzanti G, Bartolini A, Ghelardini C: Menthol: a natural analgesic compound. Neurosci Lett. 2002 Apr 12;322(3):145-8. Pubmed
  2. Taniguchi Y, Deguchi Y, Saita M, Noda K: [Antinociceptive effects of counterirritants] Nippon Yakurigaku Zasshi. 1994 Dec;104(6):433-46. Pubmed

Comments
Drug created on June 13, 2005 07:24 / Updated on February 08, 2013 16:19