IDPharmacologyInteractionsReferencesTrialsEconomicsPropertiesSpectraTaxonomy

Get DrugBank to go!

The DrugBank app for iOS and Android is coming soon.

Sign up to get early access
Identification
NameEucalyptol
Accession NumberDB03852  (EXPT00969)
TypeSmall Molecule
GroupsNutraceutical
Description

Eucalyptol is a natural organic compound which is a colorless liquid. It is a cyclic ether and a monoterpenoid. Eucalyptol is an ingredient in many brands of mouthwash and cough suppressant. It controls airway mucus hypersecretion and asthma via anti-inflammatory cytokine inhibition. Eucalyptol is an effective treatment for nonpurulent rhinosinusitis. Eucalyptol reduces inflammation and pain when applied topically. It kills leukaemia cells in vitro.

Structure
Thumb
MOLSDFPDBSMILESInChI
Synonyms
1,8-cineol
1,8-Cineole
1,8-epoxy-p-menthane
1,8-oxido-p-menthane
cajeputol
cineol
cineole
Cucalyptol
Eucapur
Zineol
External IDs Not Available
Product Ingredients Not Available
Approved Prescription ProductsNot Available
Approved Generic Prescription ProductsNot Available
Approved Over the Counter Products
NameDosageStrengthRouteLabellerMarketing StartMarketing End
Rosatra Synergy for Treatment Of Acne RosaceaOil.7 g/50gTopicalPhytopia Co., Ltd.2016-02-29Not applicableUs
Unapproved/Other Products Not Available
International Brands
NameCompany
SoledumNot Available
Brand mixtures
NameLabellerIngredients
Advanced AntisepticWakfern Food Corporation
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Advanced Antiseptic CitrusH.E.B.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Advanced CitrusWalmart Stores
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Advanced Citrus AntisepticPublix Supermarkets, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Alsirub OntAlsi Cie Ltee
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
Amber Mouth RinseFilo America
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Amber Mouth Wash - LiqPerrigo International
  1. Eucalyptol
  2. Menthol
  3. Thymol
Amber Mouthwash - LiqPerrigo International
  1. Eucalyptol
  2. Menthol
  3. Thymol
Anitseptic Mouth RinsePharmacy Vlaue Alliance Llc
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
AntisepticTarget Corporation.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Antiseptic Lil Drug Store ProductsLil' Drug Store Products, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Antiseptic Mouth RinseWalgreens
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Antiseptic Mouth Rinse - LiqPerrigo International
  1. Eucalyptol
  2. Menthol
  3. Thymol
Antiseptic MouthrinseWalmart Stores
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Antiseptic RinseMeijer
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
AntispeticWalgreen
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Antispetic Mouth RinseOnpoint, Inc
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Aurora Blue MintAPOLLO HEALTH AND BEAUTY CARE
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Aurora Fresh BurstAPOLLO HEALTH AND BEAUTY CARE
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Balminil CamphorubRougier Pharma Division Of Ratiopharm Inc
  1. Camphor
  2. Eucalyptol
  3. Menthol
Balminil Nasal OintmentRougier Pharma Division Of Ratiopharm Inc
  1. Camphor
  2. Chlorobutanol
  3. Ephedrine
  4. Eucalyptol
  5. Menthol
Being Well AntisepticSave A Lot Food Stores, Ltd.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
BiocenceBio Germ Protection Llc
  1. Eucalyptol
  2. Thymol
BorasolLaboratorios Dr. Collado, C x A.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Buenos Dias De Personna Citrus FlavourInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Buenos Dias De Personna Cool MintInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Buenos Dias De Personna MintInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Buenos Dias De Personna OriginalInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Cal Mo Dol OntHerbes Universelles Inc.
  1. Camphor
  2. Eucalyptol
  3. Menthol
  4. Methyl salicylate
  5. Peppermint oil
  6. Turpentine
Calmomusc LiqCardinaux Enrg Les Produits Naturels
  1. Eucalyptol
  2. Menthol
  3. Menthyl salicylate
Camocare Pain Relieving CreamAbkit Inc.
  1. Camphor
  2. Eucalyptol
  3. Menthol
Camphorated Ointment CompoundRougier Pharma Division Of Ratiopharm Inc
  1. Camphor
  2. Eucalyptol
  3. Menthol
CarboseptolHerbes Universelles Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
  5. Zinc oxide
Cool Mint Antiseptic MouthwashScott Chemical Canada
  1. Eucalyptol
  2. Menthol
  3. Thymol
Creo Grippe Enfants SupProduits Marc O (1987) Inc., Division Of Technilab Inc.
  1. Camphor
  2. Eucalyptol
  3. Guaifenesin
Creo Grippe Sup AdultesProduits Marc O (1987) Inc., Division Of Technilab Inc.
  1. Camphor
  2. Eucalyptol
  3. Guaifenesin
Demo Cineol InjSabex Inc
  1. Camphor
  2. Eucalyptol
  3. Guaiacol
Demo-cineol Adultes/adultsSandoz Canada Incorporated
  1. Camphor
  2. Eucalyptol
  3. Guaiacol
  4. Guaiacol
Demo-cineol Enfants/childrenSandoz Canada Incorporated
  1. Camphor
  2. Eucalyptol
  3. Guaiacol
  4. Guaiacol
Discount Drug Mart Blue Mint MouthwashDiscount Dollar Mart
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Discount Drug Mart Original Flavor MouthwashDiscount Drug Mart
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Discount Drug Mart Spring Mint MouthwashDiscount Drug Mart
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Equate Tartar Control PlusWalmart Stores
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Family Dollar Antiseptic Mouth RinseFamily Dollar
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Family Dollar Antiseptic Mouth Rinse Blue MintFamily Dollar Services
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Family Dollar Antiseptic Mouth Rinse Spring MintFamily Dollar
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Green Mint Mouth RinseFilo America
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Handy Solutions Cool Mint Listerine Antiseptic MouthwashNavajo Manuracturing Company
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Handy Solutions Listerine Antiseptic MouthwashNavajo Manuracturing Company
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Hyvee Antiseptic Blue MintHyvee
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Hyvee Antiseptic MintHyvee
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Hyvee Antiseptic OriginalHyvee
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Hyvee Blue MintHyvee
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Hyvee Health Cool Blue Sugar FreeHyvee
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Hyvee Health Green Mint Sugar FreeHyvee
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Inarub CrmFrega Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
Infraline LiqRolmex International Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
Jack and Jill RubW.K. Buckley Ltd.
  1. Camphor
  2. Eucalyptol
  3. Menthol
  4. Turpentine
Keloid Healer Synergy for Treatment Of KeloidsPhytopia Co., Ltd.
  1. Balsam of Peru
  2. Eucalyptol
Kiro-rubCentre De Recherches En Medication Naturelle Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
Larynsol LozHerbes Universelles Inc.
  1. Benzoic Acid
  2. Chlorobutanol
  3. Eucalyptol
Listerine Advanced With Tartar Protection Antiseptic CitrusJohnson & Johnson Healthcare Products, Division Of Mc Neil Ppc, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Listerine AntisepticJohnson & Johnson Healthcare Products, Division Of Mc Neil Ppc, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Listerine Cool Mint AntisepticJohnson & Johnson
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Listerine Freshburst AntisepticJohnson & Johnson
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Listerine Naturals Antiseptic - Herbal MintJohnson & Johnson Healthcare Products, Division Of Mc Neil Ppc, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Listerine Ultraclean Antiseptic Arctic MintJohnson & Johnson Healthcare Products, Division Of Mc Neil Ppc, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Listerine Ultraclean Antiseptic Cool MintJohnson & Johnson Healthcare Products, Division Of Mc Neil Ppc, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Listerine Ultraclean Antiseptic Fresh CitrusJohnson & Johnson Healthcare Products, Division Of Mc Neil Ppc, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Marco Rub Camphorated OntProduits Marc O (1987) Inc., Division Of Technilab Inc.
  1. Camphor
  2. Eucalyptol
  3. Menthol
Marcs Blue MintAPOLLO HEALTH AND BEAUTY CARE
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Marcs OriginalAPOLLO HEALTH AND BEAUTY CARE
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Marcs Spring MintAPOLLO HEALTH AND BEAUTY CARE
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Mastic DentChia Gi Ltd
  1. Eucalyptol
  2. Menthol
  3. Sodium fluoride
  4. Thymol
Mouth RinseKroger
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Onguent Camphre Menthol AlsiAlsi Cie Ltee
  1. Camphor
  2. Eucalyptol
  3. Menthol
Oral Care AntisepticRite Aid
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Oral Dent AmberInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Oral Dent Blue MintInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Oral Dent CitrusInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Oral Dent Fresh MintInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Oral-dent Blue MintInternational Cosmetic Limited
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Original AntisepticPublix
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Pastilles ValdaLabs Valda
  1. Eucalyptol
  2. Guaiacol
  3. Menthol
  4. Terpin hydrate
  5. Thymol
Peppermint Mouth RinseFilo America
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Phytorub OntPhyto Health Corporation
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
Pommade Au The Des BoisLab Valmo EnregistrÉ, Division Of Technilab Inc.
  1. Camphor
  2. Eucalyptol
  3. Menthol
  4. Methyl salicylate
Quality Choice AmberChain Drug Marketing Association
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Quality Choice Blue MintChain Drug Marketing Association
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Quality Choice Sprng MintChain Drug Marketing Association
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Rhino-vaccinRougier Pharma Division Of Ratiopharm Inc
  1. Camphor
  2. Chlorobutanol
  3. Ephedrine
  4. Eucalyptol
  5. Menthol
RinseWalgreen
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Royal Mouthwash Fresh and Clean Original MintFilo America
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Shaping With Workout - Loose Skin RevitalizerPhytopia Co., Ltd.
  1. Eucalyptol
  2. Menthol
Shaping Without WorkoutPhytopia Co., Ltd.
  1. Eucalyptol
  2. Sage oil
Slim Booster With Natural Slimming ActivatorsPhytopia Co., Ltd.
  1. Eucalyptol
  2. Sage oil
Smart Sense Blue MintKmart Corporation
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Smart Sense CitrusKmart Corporation
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Smart Sense Iceberg BlueKmart Corporation
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Smart Sense Original FlavorKmart Corporation
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Smart Sense Spring MintKmart Corporation
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Soft Mint Listerine AntisepticJohnson & Johnson Healthcare Products, Division Of Mc Neil Ppc, Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Tartar ControlWestern Family
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Tartar Control PlusWalgreen
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
  4. Thymol
Thermo Rub OntRolmex International Inc.
  1. Eucalyptol
  2. Menthol
  3. Methyl salicylate
Valda PastillesBayer Inc Consumer Care
  1. Eucalyptol
  2. Guaiacol
  3. Menthol
  4. Terpin hydrate
  5. Thymol
Valda Pastilles Lemon FlavouredLabs Valda
  1. Eucalyptol
  2. Guaiacol
  3. Menthol
  4. Terpin hydrate
  5. Thymol
Vaporisateur MedicamenteAlsi Cie Ltee
  1. Camphor
  2. Eucalyptol
  3. Menthol
  4. Thymol
Categories
UNIIRV6J6604TK
CAS number470-82-6
WeightAverage: 154.2493
Monoisotopic: 154.135765198
Chemical FormulaC10H18O
InChI KeyWEEGYLXZBRQIMU-WAAGHKOSSA-N
InChI
InChI=1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+
IUPAC Name
(1s,4s)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
SMILES
C[C@@]12CC[C@@H](CC1)C(C)(C)O2
Pharmacology
IndicationNot Available
Structured Indications Not Available
PharmacodynamicsNot Available
Mechanism of actionNot Available
Related Articles
AbsorptionNot Available
Volume of distributionNot Available
Protein bindingNot Available
MetabolismNot Available
Route of eliminationNot Available
Half lifeNot Available
ClearanceNot Available
Toxicity

Oral, rat LD50: 2480 mg/kg

Affected organisms
  • Humans and other mammals
PathwaysNot Available
Pharmacogenomic Effects/ADRs Not Available
Interactions
Drug Interactions Not Available
Food InteractionsNot Available
References
Synthesis ReferenceNot Available
General References
  1. Bastos VP, Gomes AS, Lima FJ, Brito TS, Soares PM, Pinho JP, Silva CS, Santos AA, Souza MH, Magalhaes PJ: Inhaled 1,8-cineole reduces inflammatory parameters in airways of ovalbumin-challenged Guinea pigs. Basic Clin Pharmacol Toxicol. 2011 Jan;108(1):34-9. doi: 10.1111/j.1742-7843.2010.00622.x. Epub 2010 Aug 16. [PubMed:20722639 ]
External Links
ATC CodesR05CA13 — Cineole
AHFS CodesNot Available
PDB Entries
FDA labelNot Available
MSDSDownload (74.3 KB)
Clinical Trials
Clinical Trials
PhaseStatusPurposeConditionsCount
3Unknown StatusTreatmentCoughing1
4CompletedPreventionNeonatal Infections1
4CompletedTreatmentAggressive Periodontitis1
Not AvailableRecruitingTreatmentPeriodontitis / Type 2 Diabetes Mellitus1
Pharmacoeconomics
ManufacturersNot Available
PackagersNot Available
Dosage forms
FormRouteStrength
LiquidDental
RinseOral
MouthwashOral
MouthwashBuccal
OintmentNasal
LotionTopical
SprayTopical
PowderTopical
LiquidTopical
CreamTopical
MouthwashBuccal; Oral
SuppositoryRectal
LiquidIntramuscular
LiquidOral
LozengeOral
OintmentTopical
MouthwashDental; Oral
EmulsionTopical
OilTopical.7 g/50g
OilTopical
MouthwashDental
LiquidRespiratory (inhalation)
PricesNot Available
PatentsNot Available
Properties
StateLiquid
Experimental Properties
PropertyValueSource
melting point (°C)1.5 °CPhysProp
boiling point (°C)176.4 °CPhysProp
water solubility3500 mg/L (at 21 °C)YALKOWSKY,SH & DANNENFELSER,RM (1992)
logP2.74GRIFFIN,S ET AL. (1999)
Predicted Properties
PropertyValueSource
Water Solubility0.0225 mg/mLALOGPS
logP3.36ALOGPS
logP2.35ChemAxon
logS-3.8ALOGPS
pKa (Strongest Basic)-4.2ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count1ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area9.23 Å2ChemAxon
Rotatable Bond Count0ChemAxon
Refractivity45.86 m3·mol-1ChemAxon
Polarizability18.54 Å3ChemAxon
Number of Rings2ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterNoChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleNoChemAxon
Predicted ADMET features
PropertyValueProbability
Human Intestinal Absorption+0.988
Blood Brain Barrier+0.9842
Caco-2 permeable+0.7609
P-glycoprotein substrateSubstrate0.5435
P-glycoprotein inhibitor INon-inhibitor0.6374
P-glycoprotein inhibitor IINon-inhibitor0.6455
Renal organic cation transporterNon-inhibitor0.7847
CYP450 2C9 substrateNon-substrate0.8132
CYP450 2D6 substrateNon-substrate0.7839
CYP450 3A4 substrateSubstrate0.5962
CYP450 1A2 substrateNon-inhibitor0.7719
CYP450 2C9 inhibitorNon-inhibitor0.7571
CYP450 2D6 inhibitorNon-inhibitor0.95
CYP450 2C19 inhibitorNon-inhibitor0.658
CYP450 3A4 inhibitorNon-inhibitor0.9395
CYP450 inhibitory promiscuityLow CYP Inhibitory Promiscuity0.9399
Ames testNon AMES toxic0.9574
CarcinogenicityNon-carcinogens0.7856
BiodegradationNot ready biodegradable0.8549
Rat acute toxicity1.8144 LD50, mol/kg Not applicable
hERG inhibition (predictor I)Weak inhibitor0.8743
hERG inhibition (predictor II)Non-inhibitor0.7089
ADMET data is predicted using admetSAR, a free tool for evaluating chemical ADMET properties. (23092397 )
Spectra
Mass Spec (NIST)Not Available
Spectra
Spectrum TypeDescriptionSplash Key
MSMass Spectrum (Electron Ionization)splash10-0536-9200000000-aa52695ff4a2c1313e0bView in MoNA
1D NMR1H NMR SpectrumNot Available
1D NMR13C NMR SpectrumNot Available
Taxonomy
DescriptionThis compound belongs to the class of chemical entities known as oxanes. These are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms.
KingdomChemical entities
Super ClassOrganic compounds
ClassOrganoheterocyclic compounds
Sub ClassOxanes
Direct ParentOxanes
Alternative ParentsOxacyclic compounds / Dialkyl ethers / Hydrocarbon derivatives
SubstituentsOxane / Oxacycle / Ether / Dialkyl ether / Organic oxygen compound / Hydrocarbon derivative / Organooxygen compound / Aliphatic heteropolycyclic compound
Molecular FrameworkAliphatic heteropolycyclic compounds
External Descriptorscineole (CHEBI:27961 )
Drug created on June 13, 2005 07:24 / Updated on June 11, 2017 20:50