Polymyxin B sulfateProduct ingredient for Polymyxin B

Name
Polymyxin B sulfate
Drug Entry
Polymyxin B

Polymyxin B was discovered in the 1940s5. They are basic polypeptides of about eight amino acids and have cationic detergent action on cell membranes4. Polymyxin B is used for infections with gram-negative organisms, but may be neurotoxic and nephrotoxic4,Label. All gram-positive bacteria, fungi, and the gram-negative cocci, are resistant4. It is appropriate for treatment of infections of the urinary tract, meninges, and blood stream, caused by susceptible strains of Pseudomonas aeruginosaLabel. Polymyxin B has a narrow therapeutic index and so its use is limited and unlikely to be used first line5.

Accession Number
DBSALT002841  (DB14742)
Structure
Thumb
Synonyms
Polymixin B sulfate / Polymixin B, sulfate / Polymixin B, sulphate / Polymyxin B sulphate
UNII
19371312D4
CAS Number
1405-20-5
Weight
Average: 1301.57
Monoisotopic: 1300.717306998
Chemical Formula
C56H100N16O17S
InChI Key
HFMDLUQUEXNBOP-OLYKAHIFSA-N
InChI
InChI=1S/C56H98N16O13.H2O4S/c1-7-32(4)13-11-12-16-44(75)63-36(17-23-57)51(80)72-46(34(6)74)56(85)68-39(20-26-60)48(77)67-41-22-28-62-55(84)45(33(5)73)71-52(81)40(21-27-61)65-47(76)37(18-24-58)66-53(82)42(29-31(2)3)69-54(83)43(30-35-14-9-8-10-15-35)70-49(78)38(19-25-59)64-50(41)79;1-5(2,3)4/h8-10,14-15,31-34,36-43,45-46,73-74H,7,11-13,16-30,57-61H2,1-6H3,(H,62,84)(H,63,75)(H,64,79)(H,65,76)(H,66,82)(H,67,77)(H,68,85)(H,69,83)(H,70,78)(H,71,81)(H,72,80);(H2,1,2,3,4)/t32?,33-,34-,36+,37+,38-,39+,40+,41+,42+,43-,45+,46+;/m1./s1
IUPAC Name
SMILES
OS(O)(=O)=O.[H][C@]1(NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)[C@@H](CCN)NC(=O)[C@H](CCNC1=O)NC(=O)[C@H](CCN)NC(=O)[C@@H](NC(=O)[C@H](CCN)NC(=O)CCCCC(C)CC)[C@@H](C)O)[C@@H](C)O
External Links
Human Metabolome Database
HMDB0014919
KEGG Drug
D01066
KEGG Compound
C11613
PubChem Compound
4868
PubChem Substance
46507302
ChemSpider
25049327
ChEMBL
CHEMBL1200626
Therapeutic Targets Database
DAP001323
PharmGKB
PA451027
Wikipedia
Polymyxin_B
Predicted Properties
PropertyValueSource