| Identification |
| Name |
Amphotericin B |
| Accession Number |
DB00681
(APRD00797)
|
| Type |
small molecule |
| Groups |
approved |
| Description |
Amphotericin B shows a high order of in vitro activity against many species of fungi. Histoplasma capsulatum, Coccidioides immitis, Candida species, Blastomyces dermatitidis, Rhodotorula, Cryptococcus neoformans, Sporothrix schenckii, Mucor mucedo, and Aspergillus fumigatus are all inhibited by concentrations of amphotericin B ranging from 0.03 to 1.0 mcg/mL in vitro. While Candida albicans is generally quite susceptible to amphotericin B, non-albicans species may be less susceptible. Pseudallescheria boydii and Fusarium sp. are often resistant to amphotericin B. The antibiotic is without effect on bacteria, rickettsiae, and viruses. |
| Structure |
Download:
MOL |
SDF |
SMILES |
InChI
Display:
2D Structure |
3D Structure
|
| Synonyms |
- AMPH-B
- Amphortericin B
- Amphotericine B
- Liposomal Amphotericin B
|
| Synonyms |
| AMPH-B |
| Amphortericin B |
| Amphotericine B |
| Liposomal Amphotericin B |
|
| Salts |
Not Available |
| Brand names |
| Name |
Company |
| Abelcet |
|
| ABLC |
|
| AmBisome |
|
| Ampho-Moronal |
|
| Amphocin |
|
| Amphotec |
|
| Amphotericin |
|
| Amphozone |
|
| Fungilin |
|
| Fungisone |
|
| Fungizone |
|
| Fungizone Intravenous |
|
| Halizon |
|
| HSDB 3008 IAB |
|
| LNS-AmB |
|
| Mysteclin-F |
|
| SinuNase |
|
| Tegopen |
|
|
| Brand mixtures |
Not Available |
| Categories |
- Anti-Bacterial Agents
- Antifungal Agents
- Antiprotozoal Agents
- Amebicides
|
| CAS number |
1397-89-3 |
| Weight |
Average: 924.079 Monoisotopic: 923.487849915
|
| Chemical Formula |
C47H73NO17 |
| InChI Key |
InChIKey=APKFDSVGJQXUKY-INPOYWNPSA-N |
| InChI |
InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1
Plain Text
|
| IUPAC Name |
(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid
|
| SMILES |
C[C@H]1O[C@@H](O[C@@H]2C[C@@H]3O[C@@](O)(C[C@H](O)[C@H]3C(O)=O)C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C\C=C\C=C\C=C\C=C\C=C\C=C\2)[C@@H](O)[C@@H](N)[C@@H]1O
Plain Text
|
| Mass Spec |
Not Available
|
| Taxonomy |
| Kingdom |
Organic |
| Classes |
|
| Substructures |
- Carboxylic Acids and Derivatives
- Aminoglycosides
- Hydroxy Compounds
- Alkanes and Alkenes
- Pyrans
- Acetates
- Acetals and Derivatives
- Lactones
- Aliphatic and Aryl Amines
- Ethers
- Amino Alcohols
- Alcohols and Polyols
- Heterocyclic compounds
|
| Pharmacology |
| Indication |
Used to treat potentially life threatening fungal infections. |
| Pharmacodynamics |
Amphotericin B shows a high order of in vitro activity against many species of fungi. Histoplasma capsulatum, Coccidioides immitis, Candida species, Blastomyces dermatitidis, Rhodotorula, Cryptococcus neoformans, Sporothrix schenckii, Mucor mucedo, and Aspergillus fumigatus are all inhibited by concentrations of amphotericin B ranging from 0.03 to 1.0 mcg/mL in vitro. While Candida albicans is generally quite susceptible to amphotericin B, non-albicans species may be less susceptible. Pseudallescheria boydii and Fusarium sp. are often resistant to amphotericin B. The antibiotic is without effect on bacteria, rickettsiae, and viruses. |
| Mechanism of action |
Amphotericin B is fungistatic or fungicidal depending on the concentration obtained in body fluids and the susceptibility of the fungus. The drug acts by binding to sterols (ergosterol) in the cell membrane of susceptible fungi. This creates a transmembrane channel, and the resultant change in membrane permeability allowing leakage of intracellular components. Ergosterol, the principal sterol in the fungal cytoplasmic membrane, is the target site of action of amphotericin B and the azoles. Amphotericin B, a polyene, binds irreversibly to ergosterol, resulting in disruption of membrane integrity and ultimately cell death. |
| Absorption |
Bioavailability is 100% for intravenous infusion. |
| Volume of distribution |
Not Available |
| Protein binding |
Highly bound (>90%) to plasma proteins. |
| Metabolism |
Exclusively renal |
| Route of elimination |
Not Available |
| Half life |
An elimination half-life of approximately 15 days follows an initial plasma half-life of about 24 hours. |
| Clearance |
- 39 +/- 22 mL/hr/kg [febrile neutropenic cancer and bone marrow transplant patients receiving infusion of 1 mg/kg/day at Day 1]
- 17 +/- 6 mL/hr/kg [febrile neutropenic cancer and bone marrow transplant patients receiving infusion of 1 mg/kg/day 3-20 days later]
- 51 +/- 44 mL/hr/kg [febrile neutropenic cancer and bone marrow transplant patients receiving infusion of 2.5 mg/kg/day at Day 1]
- 22 +/- 15 mL/hr/kg [febrile neutropenic cancer and bone marrow transplant patients receiving infusion of 2.5 mg/kg/day 3-20 days later]
- 21 +/- 14 mL/hr/kg [febrile neutropenic cancer and bone marrow transplant patients receiving infusion of 5 mg/kg/day at Day 1]
- 11 +/- 6 mL/hr/kg [febrile neutropenic cancer and bone marrow transplant patients receiving infusion of 5 mg/kg/day 3-20 days later]
|
| Toxicity |
Oral, rat: LD50 = >5 gm/kg. Amphotericin B overdoses can result in cardio-respiratory arrest. |
| Affected organisms |
|
| Pathways |
Not Available |
| Pharmacoeconomics |
| Manufacturers |
- Apothecon inc div bristol myers squibb
- Sigma tau pharmaceuticals inc
- Three rivers pharmaceuticals llc
- Astellas pharma us inc
- Abbott laboratories
- Abraxis pharmaceutical products
- Teva parenteral medicines inc
- X gen pharmaceuticals inc
- Bristol myers squibb co
|
| Packagers |
|
| Dosage forms |
| Form |
Route |
Strength |
| Powder, for solution |
Intravenous |
|
| Powder, for suspension |
Intravenous |
|
| Suspension |
Intravenous |
|
|
| Prices |
| Unit description |
Cost |
Unit |
| Ambisome 50 mg vial |
188.4 USD |
vial |
| Amphotec 100 mg vial |
160.0 USD |
vial |
| Amphotec 50 mg vial |
93.33 USD |
vial |
| Fungizone Iv 50 mg/vial |
72.5 USD |
vial |
| Amphotericin b powder |
29.99 USD |
g |
| Amphotericin b 50 mg vial |
24.5 USD |
vial |
| Abelcet 5 mg/ml vial p-f |
12.0 USD |
ml |
|
| Patents |
| Country |
Patent Number |
Approved |
Expires (estimated) |
| United States |
5965156 |
1996-10-12 |
2016-10-12 |
| United States |
5874104 |
1996-02-23 |
2016-02-23 |
| Canada |
1339008 |
1997-03-25 |
2014-03-25 |
| Canada |
1336890 |
1995-09-05 |
2012-09-05 |
|
| Properties |
| State |
solid |
| Melting point |
170.0 oC |
| Experimental Properties |
|
| Predicted Properties |
|
| References |
| Synthesis Reference |
Not Available
|
| General Reference |
Not Available
|
| External Links |
|
| ATC Codes |
- A01AB04
- A07AA07
- G01AA03
- J02AA01
|
| AHFS Codes |
|
| PDB Entries |
Not Available |
| FDA label |
show (1.02 MB)
|
| MSDS |
show (73.1 KB)
|
| Interactions |
| Drug Interactions |
| Drug |
Interaction |
| Colistimethate |
Amphotericin B may enhance the nephrotoxic effect of Colistimethate. Due to the potential for additive or synergistic nephrotoxicity between colistimethate and other nephrotoxic drugs, such as amphotericin B, this combination should be avoided whenever possible. If these agents must be used together, patients' renal function should be monitored closely. |
| Cyclosporine |
Monitor for nephrotoxicity |
| Tacrolimus |
Additive renal impairment may occur during concomitant therapy with Amphotericin B. Use caution during concomitant therapy. |
| Tobramycin |
Increased risk of nephrotoxicity |
|
| Food Interactions |
Not Available |