IDPharmacologyInteractionsReferencesTrialsEconomicsPropertiesSpectraTaxonomy
Targets (3)Enzymes (1)
Targets (3)Enzymes (1)Biointeractions (3)

Get DrugBank to go!

The DrugBank app for iOS and Android is coming soon.

Sign up to get early access
Identification
NameDoxylamine
Accession NumberDB00366  (APRD00937)
TypeSmall Molecule
GroupsApproved, Vet Approved
Description

Histamine H1 antagonist with pronounced sedative properties. It is used in allergies and as an antitussive, antiemetic, and hypnotic. Doxylamine has also been administered in veterinary applications and was formerly used in parkinsonism. [PubChem]

Structure
Thumb
MOLSDF3D-SDFPDBSMILESInChI View 3D Structure
Synonyms
2-(alpha-(2-(Dimethylamino)ethoxy)-alpha-methylbenzyl)pyridine
2-Dimethylaminoethoxyphenylmethyl-2-picoline
Dossilamina
Doxilamina
Doxilminio
Doxylaminum
N,N-Dimethyl-2-(1-phenyl-1-(2-pyridinyl)ethoxy)ethanamine
Phenyl-2-pyridylmethyl-beta-N,N-dimethylaminoethyl ether
External IDs Not Available
Product Ingredients
IngredientUNIICASInChI KeyDetails
Doxylamine succinateV9BI9B5YI2 562-10-7KBAUFVUYFNWQFM-UHFFFAOYSA-NDetails
Product Images
Approved Prescription ProductsNot Available
Approved Generic Prescription ProductsNot Available
Approved Over the Counter Products
NameDosageStrengthRouteLabellerMarketing StartMarketing End
7 Select Sleep AidTablet25 mg/1Oral7 Eleven2014-08-05Not applicableUs
Care One Sleep AidTablet25 mg/1OralAmerican Sales Company2004-06-29Not applicableUs
Careone Nighttime Sleep AidTablet25 mg/1OralAmerican Sales Company2016-05-06Not applicableUs
Equaline Sleep AidTablet25 mg/1OralSupervalu2004-08-10Not applicableUs
Good Neighbor Pharmacy Sleep AidTablet25 mg/1OralAmerisource Bergen1997-06-26Not applicableUs
Good Sense Sleep AidTablet25 mg/1OralL. Perrigo Company1997-04-14Not applicableUs
Harris Teeter Sleep AidTablet25 mg/1OralHarris Teeter2015-11-21Not applicableUs
Health Mart Sleep AidTablet25 mg/1OralMc Kesson2011-11-21Not applicableUs
Healthy Accents Sleep AidTablet25 mg/1OralDza Brands,2011-06-06Not applicableUs
Kirkland Signature Sleep AidTablet25 mg/1OralCostco Wholesale2003-06-27Not applicableUs
Leader Sleep AidTablet25 mg/1OralCardinal Health1997-10-21Not applicableUs
Nighttime Fast Sleep AidTablet25 mg/1OralFred's2002-04-112016-02-26Us
Nighttime Sleep AidTablet25 mg/1OralCvs Health1997-07-23Not applicableUs
Nighttime Sleep AidTablet25 mg/1OralGreat Lakes Wholesale, Marketing, and Sales, Inc.2002-04-11Not applicableUs
Nighttime Sleep AidTablet25 mg/1OralWalmart Stores2002-04-11Not applicableUs
Nighttime Sleep AidTablet25 mg/1OralCvs Health2002-04-11Not applicableUs
Nighttime Sleep AidTablet25 mg/1OralKroger2014-07-15Not applicableUs
Nighttime Sleep AidTablet25 mg/1OralBetter Living Brands2002-04-11Not applicableUs21130 0386 27 nlmimage10 e938f4e7
Nighttime Sleep AidTablet25 mg/1OralHyvee2014-12-04Not applicableUs
Nighttime SleepaidTablet25 mg/1OralWestern Family Foods1997-11-11Not applicableUs
Sambrosa Sweet Dreams NighttimeSyrup9.75 mg/5mLOralSambrosa Care Inc.2015-07-01Not applicableUs
Sleep AidTablet25 mg/1OralHannaford Brothers Company1997-02-07Not applicableUs
Sleep AidTablet25 mg/1OralH.E.B.1998-05-06Not applicableUs
Sleep AidTablet25 mg/1OralSunmark (Mckesson)2002-04-11Not applicableUs
Sleep AidTablet25 mg/1OralRite Aid2001-04-11Not applicableUs
Sleep AidTablet25 mg/1OralMeijer Distribution1997-02-21Not applicableUs
Sleep AidTablet25 mg/1OralHyvee1998-09-01Not applicableUs
Sleep AidTablet25 mg/1OralArmy + Air Force Exchange Service2002-04-11Not applicableUs
Sleep AidTablet25 mg/1OralCardinal Health2002-04-11Not applicableUs
Sleep AidTablet25 mg/1OralCostco Wholesale2002-04-11Not applicableUs
Sleep AidTablet25 mg/1OralSupervalu2002-04-11Not applicableUs
Sleep AidTablet25 mg/1OralFred's2002-04-11Not applicableUs
Sleep AidTablet25 mg/1OralKroger1997-05-02Not applicableUs
Sleep Aid NighttimeTablet25 mg/1OralCardinal Health2002-04-11Not applicableUs
Sleep Aid NighttimeTablet25 mg/1OralMc Kesson (Health Mart)2002-04-11Not applicableUs
Sleep-aidTablet25 mg/1OralH.E.B.2002-04-11Not applicableUs
Smart Sense Sleep AidTablet25 mg/1OralKmart Corporation2010-12-29Not applicableUs
Sunmark Sleep AidTablet25 mg/1OralMc Kesson2003-08-15Not applicableUs
Topcare Sleep AidTablet25 mg/1OralTopco Associates1997-01-29Not applicableUs
Unisom SleeptabsTablet25 mg/1OralChattem, Inc.2016-01-15Not applicableUs
Unisom SleeptabsTablet25 mg/1OralChattem, Inc.1978-10-18Not applicableUs
Unisom-2 TabletsTablet25 mgOralPaladin Labs Inc1987-12-31Not applicableCanada
Wal Som Nighttime Sleep AidTablet25 mg/1OralWalgreen1999-03-05Not applicableUs
Unapproved/Other Products Not Available
International BrandsNot Available
Brand mixtures
NameLabellerIngredients
7 Select Night Time Relief7 Eleven
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Acetaminophen Dextromethorphan Hbr Doxylamine Succinate Phenylephrine HClCvs Pharmacy,inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Acetaminophen Dextromethorphan Hydrobromide and Doxylamine SuccinateJ.P. BUSINESS ENTERPRISE
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Acetaminophen Dextromethorphan Hydrobromide Doxylamine Succinate Phenylephrine HydrochlorideGranules India Limited
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Acetaminophen, Dextromethorphan Hydrobromide, and Doxylamine SuccinateSpirit Pharmaceuticals, Llc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Acetaminophen,dextromethorphan,doxylamineAgile Pharmachem
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Acetaminophen/pseudoephedrine/dextromethorphan/doxylamineApotex Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Alka-seltzer Plus Day and Night Cold and Flu FormulaBayer Health Care Llc, Consumer Care
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Day and Night Multi-symptom Cold and Flu FormulaBayer Health Care Llc, Consumer Care
  1. Doxylamine
  2. Phenylephrine
Alka-seltzer Plus Day and Night Severe Cold and FluBayer
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Alka-seltzer Plus Maximum Strength Day and Night Cold and FluBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Maximum Strength Night Cold and FluBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Maximum Strength Severe Sinus Congestion and Cough Day and NightBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Maximum Strength Severe Sinus, Allergy and CoughBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Multi-smptom Cold and Flu NightBayer
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Multi-symptom Cold and Flu Day and Night Liquid GelsBayer
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Multi-symptom Cold NightBayer Health Care Llc.
  1. Acetylsalicylic acid
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Night Cold and Flu FormulaBayer Health Care Llc, Consumer Care
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Night Cold Formula (lemon)Bayer
  1. Acetylsalicylic acid
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Night Cold MedicineBayer Health Care Llc, Consumer Care
  1. Acetylsalicylic acid
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Night Severe Cold and FluBayer
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Severe Allergy Sinus Congestion and Headache FormulaBayer Health Care Llc, Consumer Care
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Alka-seltzer Plus Severe Cold and Cough NightBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Alka-seltzer Plus Severe Cough Mucus and Congestion Day and NightBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Alka-seltzer Plus Severe Sinus Congestion and Cough Day and NightBayer Health Care Llc, Consumer Care
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Severe Sinus Congestion and Cough Liquid Gels NightBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Alka-seltzer Plus Severe Sinus Congestion, Allergy and CoughBayer Health Care Llc, Consumer Care
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
All NiteMajor
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
All-nite Cold and FluMajor
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Allergy and CoughWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Aurophen Cold Multi SymptomAurohealth LLC
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Auroquil Cold and Flu Nighttime ReliefAurohealth LLC
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Auroquil Cough Nighttime Cough ReliefAurohealth LLC
  1. Dextromethorphan
  2. Doxylamine
Auroquil Severe Cold and Flu Nighttime ReliefAurohealth LLC
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Aurotussin Maximum Strength Daytime and Nighttime Cough ReliefAurohealth LLC
  1. Dextromethorphan
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
Being Well Cold and Flu Relief PMSave A Lot Food Stores, Ltd.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Being Well Cold Flu Relief PM Multi SymptomSave A Lot Food Stores, Ltd.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Being Well Night Time Cold and FluSave A Lot Food Stores, Ltd.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Buckley's Cold & Sinus NightThe Buckley's Company
  1. Acetaminophen
  2. Doxylamine
  3. Pseudoephedrine
Buckley's Complete Nighttime SoftgelsThe Buckley's Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Buckley's Nighttime Cold and SinusThe Buckley's Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Care One Cold Mutli SymptomAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Allergy and Cough Severe Sinus CongestionAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Cold and CoughAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Careone Cold MaxAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Daytime Nighttime Cold and FluAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Daytime Nighttime Cold Flu ReliefAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Night Time Cold and FluAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Careone Nighttime Cold and FluAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Careone Nighttime CoughAmerican Sales Company
  1. Dextromethorphan
  2. Doxylamine
Careone Nighttime Severe Cold and FluAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Nitetime Cold Flu ReliefAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Careone Nitetime Severe Cold Flu ReliefAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Severe Sinus CongestionAmerican Sales Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Careone Tussin DM Nighttime CoughAmerican Sales Company
  1. Dextromethorphan
  2. Doxylamine
Circle K Nighttime Cold and FluLil' Drug Store Products, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
CleartimeHyvee
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Cold & FluVita Health Products Inc
  1. Acetaminophen
  2. Acetaminophen
  3. Dextromethorphan
  4. Dextromethorphan
  5. Doxylamine
  6. Pseudoephedrine
  7. Pseudoephedrine
Cold & Flu NighttimeArrow Otc Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Cold & Flu Relief NighttimeVita Health Products Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold & Sinus Liquid CapsulesVita Health Products Inc
  1. Acetaminophen
  2. Acetaminophen
  3. Dextromethorphan
  4. Dextromethorphan
  5. Doxylamine
  6. Pseudoephedrine
  7. Pseudoephedrine
Cold and CoughH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Cough NighttimeCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Cough Nighttime Cool BlastQuality Choice (Chain Drug Marketing Association, Inc.)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and FluHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Day NightHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu Daytime NighttimeL&R Distributors, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu Daytime, Nighttime SevereWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Cold and Flu Daytime, Nighttime, Maximum StrengthWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Cold and Flu Daytime, Nighttime, Multi-symptomWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu Medicine - Night Time FormulaPharmetics (2011) Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Cold and Flu Multi-symptom Daytime NighttimeArmy + Air Force Exchange Service
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu NighttimeL&R Distributors, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Nighttime DWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Cold and Flu Nighttime Multi SymptomL&R Distributors, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Nighttime Multi-symptomCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Nighttime ReliefFred's
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Nighttime/multi-symptomWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu ReliefWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Relief Daytime NighttimeRite Aid
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu Relief Multi SymptomWin Co Foods, Llc,
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu Relief Multi Symptom NighttimeWin Co Foods, Llc,
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Relief Multi-symptomArmy + Air Force Exchange Service
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu Relief Multi-symptom, Day, NightLnk International, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Flu Relief Multi-symptom, NighttimeArmy + Air Force Exchange Service
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Relief NighttimeAmerisource Bergen (Good Neighbor Pharmacy) 46122
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Relief Nighttime Multi SymptomP And L Development Of New York Corporation (Ready In Case)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Relief Nighttime, Multi-symptomArmy + Air Force Exchange Service
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cold and Flu Relief Non-drowsy / Daytime Severe / Nighttime SevereCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Cold and Flu Severe, Nighttime, Maximum StrengthWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold and Sinus Nighttime ReliefVita Health Products Inc
  1. Acetaminophen
  2. Doxylamine
  3. Pseudoephedrine
Cold and Sinus Relief ComboVita Health Products Inc
  1. Acetaminophen
  2. Acetaminophen
  3. Doxylamine
  4. Pseudoephedrine
  5. Pseudoephedrine
Cold Flu ReliefPerrigo International
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Cold Max NighttimeP & L Development, LLC
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold Multi SymptomH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold Relief Multi Symptom NighttimeCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cold/flu MedicinePerrigo International
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Complete Liquid CapsulesVita Health Products Inc
  1. Acetaminophen
  2. Acetaminophen
  3. Dextromethorphan
  4. Dextromethorphan
  5. Doxylamine
  6. Guaifenesin
  7. Pseudoephedrine
  8. Pseudoephedrine
Complete Liquid Capsules Nighttime ReliefVita Health Products Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Conrx NighttimeEagle Distributors,Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Contac Cold and Flu Cooling ReliefMeda Pharmaceuticals Ltd
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Core Values Night Time ReliefHarmon Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Coricidin Hbp Nighttime Multi-symptom ColdBayer Health Care Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
CoughHyvee
  1. Dextromethorphan
  2. Doxylamine
Cough and Sore Throat Multi SymptomMeijer Distribution
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cough and Sore Throat NighttimeKinray
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cough and Sore Throat Pain ReliefHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cough Day NightHyvee
  1. Dextromethorphan
  2. Doxylamine
Cough Multi SymptomKinray
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Cough Nighttime Cough ReliefChain Drug Consortium
  1. Dextromethorphan
  2. Doxylamine
Cough Relief Daytime NighttimeWalgreen
  1. Dextromethorphan
  2. Doxylamine
Cough Relief NighttimeWalgreen
  1. Dextromethorphan
  2. Doxylamine
Cvs Daytime Cold and Flu Relief and Nighttime Cold and Flu ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Cvs Health Nighttime Cold and Flu Relief Single Serve Cups Cold and Flu Nighttime ReliefCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Cvs Nighttime Cold/flu ReliefCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
DalmacolLaboratoire Riva Inc
  1. Doxylamine
  2. Etafedrine
  3. Ethanol
  4. Hydrocodone
  5. Sodium Citrate
Day Cold and Flu Plus and Nighttime Cold and Flu PlusPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Day Night Cold and FluHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Day Relief Night Relief FreeWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Day Relief Night Relief Sinus PEWestern Family Foods
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Day Time and Night Time Cold and Flu FormulaPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Day Time and Night Time Sinus and CongestionWalgreens
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Day Time Night TimeShopko Stores Operating
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Day Time Night Time Cold and FluWalgreens
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Day Time Night Time Sinus ReliefWalgeens Company
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Day Time Nighttime CoughHyvee
  1. Dextromethorphan
  2. Doxylamine
Day-time Night-timeChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime and Nighttime Cold and FluPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime and Nighttime Cold and Flu ReliefChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime and Nighttime Cold and Flu Relief PlusChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime and Nighttime Cough ReliefCvs Health
  1. Dextromethorphan
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
Daytime and NitetimePura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Cold and Flu and Nighttime Cold and FluKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Cold and Flu Severe and Nighttime Cold and Flu SevereTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Daytime Cough Nighttime CoughCvs Health
  1. Dextromethorphan
  2. Doxylamine
Daytime NighttimeShopko Stores Operating
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime CleartimeHyvee
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Daytime Nighttime Cold and FluSafeway
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime Cold and Flu ReliefRite Aid
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime Cold and Flu Relief Multi-symptomFamily Dollar (FAMILY WELLNESS)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime Cold Flu ReliefSafeway
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime Cold/fluQuality Choice (Chain Drug Marketing Association, Inc.)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime Multi Symptom Cold and Flu ReliefShopko Stores Operating
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime Multi Symptom Cold Flu ReliefCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nighttime Severe Cold and FluHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Daytime Nighttime Severe Cold and Flu ReliefRite Aid
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Daytime Nighttime Sinus ReliefHyvee
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Daytime Nite TimeKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime NitetimeKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nitetime Cold and FluKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nitetime Cold and Flu ReliefCare One (American Sales Company)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nitetime Cold Flu ReliefCare One (American Sales Company)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Nitetime SinusMeijer Distribution
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Daytime Nitetime Sinus ReliefTopcare (Topco Associates Llc)
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Daytime PE NitetimePublix Supermarkets, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime Sinus Relief and Nighttime Sinus ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Daytime/nighttime Cold and Flu Multi-symptom ReliefL&R Distributors, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Daytime/nitetime Severe Cold and Flu Maximum StrengthMeijer Distribution
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Ddm Day Time and Nite Time Cold and FluPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Delsym Night Time Multi-symptomReckitt Benckiser
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Dg Day Time Cold and Flu Formula and Night Time Cold and Flu FormulaPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Dg Health Cold and Flu ReliefDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Dg Health Cold and Flu Relief Night TimeDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Dg Health Cold and Flu Relief Nite TimeDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Dg Health Cold MaxDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Dg Health Cough and Sore Throat Nite TimeDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Dg Health Cough Night TimeDolgencorp
  1. Dextromethorphan
  2. Doxylamine
Dg Health Night Time Cold and Flu ReliefDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Dg Health Pain Relief Cold Night TimeDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Dg Health TussinDolgencorp
  1. Dextromethorphan
  2. Doxylamine
DiclectinDuchesnay Inc.
  1. Doxylamine
  2. Pyridoxine
DiclegisDuchesnay Inc.
  1. Doxylamine
  2. Pyridoxine
Equaline Daytime and Nighttime Cold and Flu ReliefSupervalu
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Equaline Daytime Nighttime Cold and Flu ReliefSupervalu
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Equaline Night Time CoughSupervalu
  1. Dextromethorphan
  2. Doxylamine
Equaline NighttimeSupervalu
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Equaline Nighttime Cold and Flu ReliefSupervalu
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Equaline Nighttime Cough ReliefSupervalu
  1. Dextromethorphan
  2. Doxylamine
Equaline Nighttime Severe Cold and FluSupervalu
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Equate Daytime NitetimeWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Equate Daytime Nitetime SevereWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Equate Nighttime Liquid CapsulesIvax Pharmaceuticals Incorporated
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Equate Nite Time Cold Flu ReliefWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Equate Nite Time CoughWalmart Stores
  1. Dextromethorphan
  2. Doxylamine
Equate NitetimeWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Equate Nitetime Cold and FluWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Equate Nitetime DaytimeWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Equate Nitetime SevereWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Equate Sinus Night TimeWalmart Stores
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Extra Strength Tylenol Cold and Flu NighttimeMcneil Consumer Healthcare Division Of Johnson & Johnson Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Family Care Cold and Flu Multi SymptomUnited Exchange Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Family Care Cold and Flu NighttimeUnited Exchange Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Family Care Cough NighttimeUnited Exchange Corporation
  1. Dextromethorphan
  2. Doxylamine
Fulton Street Market Cold and FluAccess Business Group
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Fulton Street Market Night Time Cold and FluAccess Business Group
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
GlentussGlendale Inc
  1. Dextromethorphan
  2. Doxylamine
  3. Pseudoephedrine
Good Neighbor Pharmacy Cold Multi SymptomAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Neighbor Pharmacy Cough and Sore ThroatAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Neighbor Pharmacy Multi SymptomAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Neighbor Pharmacy Night TimeAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Neighbor Pharmacy Night Time Cold and FluAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Neighbor Pharmacy Night Time CoughAmerisource Bergen
  1. Dextromethorphan
  2. Doxylamine
Good Neighbor Pharmacy Night Time DAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Good Neighbor Pharmacy Night Time SevereAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Neighbor Pharmacy Severe Night TimeAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Neighbor Pharmacy Severe Sinus CongestionAmerisource Bergen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Neoghbor Pharmacy Tussin DM Max Nighttime CoughAmerisource Bergen
  1. Dextromethorphan
  2. Doxylamine
Good Sense Cough and Sore Throat Night TimeL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Sense Daytime Night TimeL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Sense Night TimeL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Sense Night Time Cold and FluL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Sense NighttimeL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Good Sense Nighttime CoughL. Perrigo Company
  1. Dextromethorphan
  2. Doxylamine
Good Sense Nighttime Daytime Cold and FluL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Sense Severe NighttimeL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Sense Severe Nighttime Cold and FluL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Good Sense Severe Sinus CongestionL. Perrigo Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Harmon Face Values Night Time ReliefHarmon Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Harris Teeter Daytime NighttimeHarris Teeter
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Harris Teeter NighttimeHarris Teeter
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Harris Teeter Nighttime Cold and FluHarris Teeter
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Health Mart Multi-symptom Cold and Flu Night TimeMc Kesson (Health Mart)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Health Mart Night Time Cold and FluMc Kesson
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Healthy Accents Cold and CoughDza Brands,
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Healthy Accents Cough and Sore Throat Night TimeDza Brands,
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Healthy Accents Day Time Night TimeDza Brands,
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Healthy Accents Daytime Nighttime Cold and FluDza Brands,
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Healthy Accents Night Time CoughDza Brands,
  1. Dextromethorphan
  2. Doxylamine
Healthy Accents Nighttime Cold and FluDza Brands,
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Heb Day Time Night Time Severe Cold and FluH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Leader Nighttime Cold and FluCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Leader Nighttime CoughCardinal Health
  1. Dextromethorphan
  2. Doxylamine
Leader Nighttime Severe Cold and FluCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Leader Nite TimeCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Leader Nite Time Cold Flu Relief Multi SymptomCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Leader Nite Time CoughCardinal Health
  1. Dextromethorphan
  2. Doxylamine
Leader Nite Time Multi Symptom Cold and Flu ReliefCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Leader Nite Time Multi Symptom Cold Flu ReliefCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Leader Nite Time Severe Cold and FluCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Leader Severe Sinus CongestionCardinal Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Lil Drug Store Nyquil Severe Cold and Flu, Max StrengthLil' Drug Store Products, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Lortuss DMPoly Pharmaceuticals
  1. Dextromethorphan
  2. Doxylamine
Lortuss LqPoly Pharmaceuticals
  1. Doxylamine
  2. Pseudoephedrine
Major Night Time Multi Symptom Cold and Flu ReliefMajor
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Maximum Strength Night Time Cold and Flu ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Maximum Strength Nighttime Cold/flu ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Mckesson Nite TimeMc Kesson
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Mercodol With DecaprynAventis Pharma Ltd.
  1. Doxylamine
  2. Etafedrine
  3. Hydrocodone
  4. Sodium Citrate
Mersyndol With CodeineSanofi Aventis
  1. Acetaminophen
  2. Codeine
  3. Doxylamine
Mucinex Fast-max Day Severe Cold and Night Cold and FluReckitt Benckiser
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Mucinex Fast-max Night Time Cold and FluReckitt Benckiser
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Mucinex Sinus - Max Day / NightReckitt Benckiser
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Multi Symptom Cold and Flu Relief NighttimeSMART SENSE (Kmart)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Multi Symptom Nighttime Cold and Flu ReliefChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Multi Symptom NitetimeCare One (American Sales Company)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Multi-symptom Daytime and Nighttime Cold and Flu Relief PlusWalgreens
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Multi-symptom Nighttime Sinus ReliefPura Vation Pharmaceuticals Inc
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Multi-symptom NitetimeP And L Development Of New York Corporation (Ready In Case)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
N - TimeSpirit Pharmaceuticals, Llc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
N - Time SinusSpirit Pharmaceuticals, Llc
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Neocitran Cold & Flu SyrupNovartis
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Next Cold and Flu NighttimeGenomma Lab
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Next Night Severe Cold, Flu and Sore ThroatGenomma Lab
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Next Night Time Cold and Flu ReliefGenomma Lab
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nicold Medicine for AdultsTanta Pharmaceuticals Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Night Cold Flu Cough and AllergyHumanwell Pura Cap Pharmaceutical (Wuhan), Ltd.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Night ReliefWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Relief Cold and Flu Liquid CapsulesBanner Pharmacaps
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Night Relief CoughWestern Family Foods
  1. Dextromethorphan
  2. Doxylamine
Night Relief FreeWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Relief Multi Symptom Cold and FluWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Relief SinusWestern Family Foods
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Night TimeShopko Stores Operating
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time CherryDollar General
  1. Dextromethorphan
  2. Doxylamine
Night Time Cherry Pseudo-freeSafeway
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold and FluSafeway
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Night Time Cold and Flu CherryMarc Glassman, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold and Flu FormulaPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Night Time Cold and Flu Multi SymptomH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold and Flu OriginalMarc Glassman, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold and Flu ReadyincaseP & L Development, LLC
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold and Flu ReliefDolgencorp, Inc. (Dollar General & Rexall)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold and Flu Relief Multi SymptomFred's
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold and Flu SevereTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Night Time Cold and Flue ReliefAllegiant Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold MaxDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Night Time Cold/flu Relief CherryKareway Product, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold/flu Relief Multi SymptomShopko Stores Operating
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cold/flu Relief OriginalKareway Product, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time CoughSafeway
  1. Dextromethorphan
  2. Doxylamine
Night Time Cough and Sore Throat Cool BlastCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Cough CherryRite Aid
  1. Dextromethorphan
  2. Doxylamine
Night Time Cough ReliefH.E.B.
  1. Dextromethorphan
  2. Doxylamine
Night Time Day Time Cold and FluHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Night Time GelcapKareway Product, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Liquid Caps Cold Flu Multi SymptomH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Multi Symptom Cold/flu ReliefFred's
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Multi Symptom Flu Cold MedicineSalado Sales, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Multi Symptom ReliefStrides Pharma Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Night Time Multi-symptom Cold/flu ReliefChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Original Pseudo-freeSelect Brand
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time Pseudo-freeRite Aid
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night Time ReliefStrides Pharma Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Night Time Severe Cold and Flu ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Night Time SinusFred's
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Night Time Sinus and CongestionChain Drug Consortium
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Night Time Sinus ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Night Time SoftgelsStrides Pharma Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night-time Cherry Multi-symptom Cold/flu ReliefChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night-time Cough ReliefDiscount Drug Mart
  1. Dextromethorphan
  2. Doxylamine
Night-time Multi-symptom Cold/flu CherryDe Moulas Market Basket
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night-time Multi-symptom Cold/flu OriginalDe Moulas Market Basket
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night-time Multi-symptom Cold/flu ReliefDiscount Drug Mart
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Night-time Original Multi-symptom Cold/flu ReliefChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nightcap Cold and Flu Liquid GelsAccucaps Industries Limited
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nightcap Complete Liquid GelsAccucaps Industries Limited
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nightrelief DayreliefWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nightrelief Free Multi Symptom Cold FluWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
NighttimeHannaford Brothers Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime 325 Liqua CapsJamp Pharma Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime Cold & Flu Liquid CapsulesVita Health Products Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime Cold & Flu ReliefApotex Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold & Flu Relief SyrupPharmetics (2011) Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime Cold and FluShopko Stores Operating
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu CherrySelect Brand Dist.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu Extra Strength MedicineJamp Pharma Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime Cold and Flu Lil Drug Store ProductsLil' Drug Store Products, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu Liquid CapsulesVita Health Products Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime Cold and Flu Multi SymptomMc Kesson (Health Mart)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu OriginalMarc Glassman, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu ReadyincaseP & L Development, LLC
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu ReliefWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu Relief Multi-symptomFamily Dollar (FAMILY WELLNESS)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold and Flu Relief PlusChain Drug Consortium
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime Cold Flu ReliefLIVE BETTER (The Great Atlantic & Pacific Tea Company)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cold MaxFamily Dollar
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime Cold MedicineJamp Pharma Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime Cold Multi-symptom Cool BlastAmerisource Bergen (Good Neighbor Pharmacy) 46122
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime CoughWalgreen
  1. Dextromethorphan
  2. Doxylamine
Nighttime Cough All Night Cough ReliefP & L Development, LLC
  1. Dextromethorphan
  2. Doxylamine
Nighttime Cough and Sore Throat LiquidJamp Pharma Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Cough DM Maximum StrengthWin Co Foods, Llc,
  1. Dextromethorphan
  2. Doxylamine
Nighttime Cough ReliefFred's
  1. Dextromethorphan
  2. Doxylamine
Nighttime Cough. Cold. Flu Gel CapsulesApotex Inc., Private Label Division
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime D Cold and FluHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime D Cold and Flu ReliefWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime Daytime CoughWalgreen
  1. Dextromethorphan
  2. Doxylamine
Nighttime Liqua CapsJamp Pharma Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nighttime Maximum Strength Cold and FluChain Drug Marketing Association
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime Multi SymptomCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Multi Symptom Cold and Flu ReliefFamily Dollar (FAMILY WELLNESS)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Multi-symptom Cold and Flu ReliefWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Multi-symptom Flu ColdSalado Sales, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nighttime Relief Severe Cold and FluFred's
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime SevereShopko Stores Operating
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime Severe Cold and FluH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime Severe Cold and Flu ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nighttime SinusGood Sense (Geiss, Destin & Dunn, Inc.)
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Nighttime Sinus and Congestion ReliefPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Nighttime Sinus Multi SymptomChain Drug Consortium
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Nighttime Sinus ReliefHumanwell Pura Cap Pharmaceutical (Wuhan), Ltd.
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Nite TimeKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Cold and FluRite Aid
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Cold and Flu ReliefKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Cold Flu ReliefWe Care Distributor Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Cold MedicineRij Pharmaceutical Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Cold Medicine Cherry FlavorRij Pharmaceutical Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Cold/flu ReliefNash Finch Company (Our Family)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Day TimeKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nite Time Multi Symptom Cold Flu ReliefKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Multi Symptom Cold/fluKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite Time Severe Cold and Flu Maximum StrengthMeijer Distribution
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nite-time Cold and Flu Multi-symptom ReliefPreferred Plus (Kinray)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite-time Cold/flu OriginalSalado Sales, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nite-timecold/flu Cherry Cold/flu CherrySalado Sales, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nitecap Sinus Liquid GelsAccucaps Industries Limited
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
NitetimeKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nitetime Cold and FluKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nitetime Cold and Flu ReliefCare One (American Sales Company)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nitetime Cold Flu ReliefMeijer
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nitetime Cold MedicineIvc Industries, Hall Division
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nitetime Cold Medicine LiqJamp Pharma Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nitetime Cold Medicine Original and CherryWestcan Pharmaceuticals Ltd.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nitetime Cold Plus Flu ReleifDolgencorp, Inc. (Dollar General & Rexall)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nitetime Cold/flu, Multi-symptom ReliefWalmart Stores
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nitetime CoughKroger
  1. Dextromethorphan
  2. Doxylamine
Nitetime Cough Daytime CoughMeijer Distribution
  1. Dextromethorphan
  2. Doxylamine
Nitetime DMeijer Distribution
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nitetime D Multi Symptom Cold Flu ReliefMeijer Distribution
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nitetime Daytime Cold and FluMeijer Distribution
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nitetime Daytime Severe Cold and FluKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Nitetime Multi-symptom Cold/flu ReliefGreenbrier International, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nitetime Severe Cold and FluKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nitetime Severe Cold and Flu ReliefWestern Family Foods
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nitetime SinusMeijer
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Nitetime Sinus ReliefTopcare (Topco Associates Llc)
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Nyquil Cold and FluLil' Drug Store Products, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Nyquil LiquicapsProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Nyquil SevereNavajo Manuracturing Company
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nyquil Severe Cold and FluJc World Bell Wholesale Co., Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Nyquil Sinus LiquicapsProcter And Gamble
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Original Night-time Multi-symptom Cold/flu ReliefDiscount Drug Mart
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
P.M. Cold Relief FormulaIvax Pharmaceuticals Incorporated
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Poly Hist FortePoly Pharmaceuticals
  1. Doxylamine
  2. Phenylephrine
Preferred Plus Severe Nite TimeKinray
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Preferred Plus Severe Sinus CongestionKinray
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Publix Cherry Flavor NitetimePublix Supermarkets, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Quality Choice Nighttime Cold and FluQuality Choice (Chain Drug Marketing Association, Inc.)
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Ratio-calmydoneTeva
  1. Doxylamine
  2. Etafedrine
  3. Hydrocodone
  4. Sodium Citrate
Regular Strength Sinus MedicationVita Health Products Inc
  1. Acetaminophen
  2. Doxylamine
  3. Pseudoephedrine
Rexall Daytime Nighttime Cold and FluDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Rexall Daytime Nighttime Cold FluDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Rexall Night Time Cold and FluDolgencorp
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Robitussin Complete NighttimePfizer Laboratories Div Pfizer Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Robitussin Maximum Strength Nighttime Cough DMRichmond Division of Wyeth
  1. Dextromethorphan
  2. Doxylamine
Robitussin Peak Cold Nighttime Cold Plus FluRichmond Division of Wyeth
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Rx Act Cough and Sore ThroatH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Rx Act Nighttime Cold Flu Relief Multi SymptomH.E.B.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Safetussin PMKramer Laboratories
  1. Dextromethorphan
  2. Doxylamine
Safeway Nighttime Cold and FluSafeway
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Sanaflu Night-time Xtreme Multi-symptom Cold/flu Relief Cherry FlavorGrandall Distributing Co., Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Sanatos NightPharmalab Enterprises Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Sever Daytime Cold and Flu and Sever Nighttime Cold and FluKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Severe Cold and FluHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Cold and Flu Daytime/nighttimeTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Severe Cold and Flu Night TimeHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Cold and Flu NighttimeTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Cold and Flu Nighttime DaytimeHyvee
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Cold and Flu ReliefRite Aid
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Cold and Flu Relief NighttimeRite Aid
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Cold Plus Flu Daytime NighttimeCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Severe NighttimeCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Nighttime Cold and FluWalgreens
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Nighttime Severe DaytimeCvs Health
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Sinus CongestionKroger
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Severe Sinus Congestion Allergy and Cough FormulaPura Cap Pharmaceutical Llc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Shoprite Ni CalmWakfern Food Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Shoprite Ni Calm CoughWakfern Food Corporation
  1. Dextromethorphan
  2. Doxylamine
Signature Care Nighttime Severe Cold and Flu ReliefSafeway
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Simply Right Night TimeSam's West, Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
SinexProcter And Gamble
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Sinex Nighttime SinusProcter And Gamble
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Sinus Day/night Extra StrengthPharmetics (2011) Inc.
  1. Acetaminophen
  2. Acetaminophen
  3. Doxylamine
  4. Pseudoephedrine
  5. Pseudoephedrine
Sinus MedicationVita Health Products Inc
  1. Acetaminophen
  2. Doxylamine
  3. Pseudoephedrine
Sinus Medication Day & NightVita Health Products Inc
  1. Acetaminophen
  2. Acetaminophen
  3. Doxylamine
  4. Pseudoephedrine
  5. Pseudoephedrine
Sinus Medication Extra Strength Night TimePharmascience Inc
  1. Acetaminophen
  2. Doxylamine
  3. Pseudoephedrine
Sinus Medication Night TabletsPharmetics (2011) Inc.
  1. Acetaminophen
  2. Doxylamine
  3. Pseudoephedrine
Sinus NighttimeCare One (American Sales Company)
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Sinus Relief Daytime NighttimeWalgreen
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Smart Sense Daytime Nighttime Cold and FluKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Smart Sense NighttimeKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Smart Sense Nighttime Cold and FluKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Smart Sense Nighttime Cold and Flu Relief Multi SymptomKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Smart Sense Nighttime CoughKmart Corporation
  1. Dextromethorphan
  2. Doxylamine
Smart Sense Nighttime DaytimeKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Smart Sense Severe Cold and Flu NighttimeKmart Corporation
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Smith Bros Night Time Cough and CongestionUniversal Holdings I Llc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Sound Body Cold and Flu ReliefBig Lots Stores, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Sunmark Nite TimeMc Kesson
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Sunmark Nite Time Cold and FluMc Kesson
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Sunmark Nite Time CoughMc Kesson
  1. Dextromethorphan
  2. Doxylamine
Sunmark Nite Time D Cold and FluMc Kesson
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Target Cold/flu ReliefTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Clear TimeTopco Associates
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Topcare Cold and CoughTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Cold MaxTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Topcare Cough and Sore ThroatTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Day Time Nite TimeTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Topcare Day Time Nite Time Cold and FluTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Topcare Day Time Nite Time Cold and Flu ReliefTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Topcare Daytime Nighttime Clear TimeTopco Associates
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Topcare Nite TimeTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Nite Time Cold and FluTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Nite Time Cold and Flu ReliefTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Nite Time Cold and Flu Relief Multi Symptom ReliefTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Nite Time CoughTopco Associates
  1. Dextromethorphan
  2. Doxylamine
Topcare Nite Time DTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Topcare Nite Time Day Time Cold and FluTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Topcare Nite Time Day Time Cold and Flu ReliefTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Topcare Nite Time Multi Symptom ReliefTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Topcare Pain Relief Cold NightttimeTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Topcare Severe Sinus CongestionTopco Associates
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Topcare Tussin DM Nighttime CoughTopco Associates
  1. Dextromethorphan
  2. Doxylamine
Tussin DM Cough Nighttime Maximum StrengthP & L Development, LLC
  1. Dextromethorphan
  2. Doxylamine
Tussin DM Maximum StrengthCvs Health
  1. Dextromethorphan
  2. Doxylamine
Tussin Nighttime Cough ControlHyvee
  1. Dextromethorphan
  2. Doxylamine
Tussin Nighttime Cough DM Maximum StrengthFamily Dollar (FAMILY WELLNESS)
  1. Dextromethorphan
  2. Doxylamine
Tylenol Cold & Flu NighttimeMcneil Consumer Healthcare Division Of Johnson & Johnson Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Tylenol Cold and Flu NighttimeMcneil Consumer Healthcare Division Of Johnson & Johnson Inc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Tylenol Cold Max NightJohnson & Johnson Consumer Inc., Mc Neil Consumer Healthcare Division
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Tylenol Cold Multi-symptomJohnson & Johnson Consumer Inc., Mc Neil Consumer Healthcare Division
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Tylenol Cold Plus Flu Severe and Tylenol Cold MaxJohnson & Johnson Consumer Inc., Mc Neil Consumer Healthcare Division
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Up and Up Cold and Flu ReliefTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Up and Up Cold and Flu Relief Multi Symptom Day and Night Combo PackTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Up and Up Cold Flu ReliefTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Up and Up Cold Flu Relief Day NightTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Up and Up Cold Flu Relief Multi Symptom NightTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Up and Up Daytime Nighttime Cold and FluTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Up and Up Nighttime Cold and FluTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Up and Up Nighttime Cough ControlTarget Corporation.
  1. Dextromethorphan
  2. Doxylamine
Up and Up Nighttime Daytime Cold and FluTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Up and Up Severe Cold and FluTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Up and Up Severe Cold and Flu NighttimeTarget Corporation.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Dayquil and Vicks Nyquil Cherry Cold and FluProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Dayquil and Vicks Nyquil Cold and FluProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Dayquil and Vicks Nyquil Cold and Flu Multi-symptom Relief/cold and Flu Nighttime ReliefProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Dayquil and Vicks Nyquil Severe Cold and FluProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Guaifenesin
  5. Phenylephrine
Vicks Dayquil Tropical and Vicks Nyquil Cherry CoughProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Nyquil Adult Nighttime Colds MedicineProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Vicks Nyquil Cold & Flu Nighttime ReliefProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Vicks Nyquil Cold and FluMechanical Servants, Llc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Vicks Nyquil Cold and Flu Nighttime ReliefProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Vicks Nyquil Cold and Flu Nighttime Relief and Vicks Childrens Nyquil Cold and CoughProcter And Gamble
  1. Acetaminophen
  2. Chlorphenamine
  3. Dextromethorphan
  4. Doxylamine
Vicks Nyquil Complete Cold & FluProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Nyquil Complete Cold & Flu CapletsProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Nyquil CoughProcter And Gamble
  1. Dextromethorphan
  2. Doxylamine
Vicks Nyquil D Cold and Flu Nighttime ReliefProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Vicks Nyquil Hbp Cold and FluProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Vicks Nyquil LiquicapsProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Pseudoephedrine
Vicks Nyquil Liquicaps Cold & Flu Multi-symptom ReliefProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Vicks Nyquil Severe Cold and FluProcter And Gamble
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
  4. Phenylephrine
Vicks Nyquil Sinus LiquicapsProcter And Gamble
  1. Acetaminophen
  2. Doxylamine
  3. Pseudoephedrine
Vicks Qlearquil Daytime Sinus and Congestion and Nighttime Sinus and CongestionProcter And Gamble
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Vicks Qlearquil Nighttime Sinus and CongestionProcter And Gamble
  1. Acetaminophen
  2. Doxylamine
  3. Phenylephrine
Walgreen Nighttime Cold and Flu ReliefWalgreen
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Waltussin DM MaxWalgreen
  1. Dextromethorphan
  2. Doxylamine
  3. Guaifenesin
ZicamMatrixx Initiatives, Inc.
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Zicam Multi-symptom Cold & Flu NighttimeZicam Llc
  1. Acetaminophen
  2. Dextromethorphan
  3. Doxylamine
Categories
UNII95QB77JKPL
CAS number469-21-6
WeightAverage: 270.3694
Monoisotopic: 270.173213336
Chemical FormulaC17H22N2O
InChI KeyHCFDWZZGGLSKEP-UHFFFAOYSA-N
InChI
InChI=1S/C17H22N2O/c1-17(20-14-13-19(2)3,15-9-5-4-6-10-15)16-11-7-8-12-18-16/h4-12H,13-14H2,1-3H3
IUPAC Name
dimethyl({2-[1-phenyl-1-(pyridin-2-yl)ethoxy]ethyl})amine
SMILES
CN(C)CCOC(C)(C1=CC=CC=C1)C1=CC=CC=N1
Pharmacology
Indication

Used alone as a short-term sleep aid, in combination with other drugs as a night-time cold and allergy relief drug. Also used in combination with Vitamin B6 (pyridoxine) to prevent morning sickness in pregnant women.

Structured Indications
Pharmacodynamics

Doxylamine is an antihistamine commonly used as a sleep aid. This drug is also used to relieve symptoms of hay fever (allergic rhinitis), hives (rash or itching), and other allergic reactions. Doxylamine is a member of the ethanolamine class of antihistamines and has anti-allergy power far superior to virtually every other antihistamine on the market, with the exception of diphenhydramine (Benadryl). It is also the most powerful over-the-counter sedative available in the United States, and more sedating than many prescription hypnotics. In a study, it was found to be superior to even the barbiturate, phenobarbital for use as a sedative. Doxylamine is also a potent anticholinergic.

Mechanism of action

Like other antihistamines, doxylamine acts by competitively inhibiting histamine at H1 receptors. It also has substantial sedative and anticholinergic effects.

TargetKindPharmacological actionActionsOrganismUniProt ID
Histamine H1 receptorProteinyes
antagonist
HumanP35367 details
Muscarinic acetylcholine receptor M1Proteinunknown
antagonist
HumanP11229 details
Nuclear receptor subfamily 1 group I member 3ProteinunknownNot AvailableHumanQ14994 details
Related Articles
Absorption

Readily absorbed via the gastrointestinal tract.

Volume of distributionNot Available
Protein bindingNot Available
Metabolism

Hepatic.

Route of eliminationNot Available
Half life

10 hours

ClearanceNot Available
Toxicity

Signs of overdose include wheezing, tightness in the chest, fever, itching, bad cough, blue skin color, fits, swelling of face, lips, tongue, or throat.

Affected organisms
  • Humans and other mammals
PathwaysNot Available
Pharmacogenomic Effects/ADRs Not Available
Interactions
Drug Interactions
DrugInteractionDrug group
2,5-Dimethoxy-4-ethylamphetamine2,5-Dimethoxy-4-ethylamphetamine may decrease the sedative activities of Doxylamine.Experimental, Illicit
3,4-Methylenedioxyamphetamine3,4-Methylenedioxyamphetamine may decrease the sedative activities of Doxylamine.Experimental, Illicit
3,4-Methylenedioxymethamphetamine3,4-Methylenedioxymethamphetamine may decrease the sedative activities of Doxylamine.Experimental, Illicit
4-Bromo-2,5-dimethoxyamphetamine4-Bromo-2,5-dimethoxyamphetamine may decrease the sedative activities of Doxylamine.Experimental, Illicit
7-NitroindazoleDoxylamine may increase the central nervous system depressant (CNS depressant) activities of 7-Nitroindazole.Experimental
7,8-Dichloro-1,2,3,4-tetrahydroisoquinoline7,8-DICHLORO-1,2,3,4-TETRAHYDROISOQUINOLINE may increase the anticholinergic activities of Doxylamine.Experimental
AcepromazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Acepromazine.Approved, Vet Approved
AceprometazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Aceprometazine.Approved
AdipiplonDoxylamine may increase the central nervous system depressant (CNS depressant) activities of adipiplon.Investigational
AgomelatineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Agomelatine.Approved, Investigational
AlfaxaloneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Alfaxalone.Vet Approved
AlfentanilDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Alfentanil.Approved, Illicit
AllopregnanoloneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Sage 547.Investigational
AlphacetylmethadolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Alphacetylmethadol.Experimental, Illicit
AlprazolamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Alprazolam.Approved, Illicit, Investigational
AmisulprideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Amisulpride.Approved, Investigational
AmitriptylineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Amitriptyline.Approved
AmobarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Amobarbital.Approved, Illicit
AmoxapineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Amoxapine.Approved
AmperozideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Amperozide.Experimental
AmphetamineAmphetamine may decrease the sedative activities of Doxylamine.Approved, Illicit
AripiprazoleDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Aripiprazole.Approved, Investigational
ArticaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Articaine.Approved
AsenapineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Asenapine.Approved
AzelastineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Azelastine.Approved
BaclofenDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Baclofen.Approved
BarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Barbital.Illicit
BenmoxinBenmoxin may increase the anticholinergic activities of Doxylamine.Withdrawn
BenperidolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Benperidol.Investigational
BenzocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Benzocaine.Approved
BenzphetamineBenzphetamine may decrease the sedative activities of Doxylamine.Approved, Illicit
Benzyl alcoholDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Benzyl alcohol.Approved
Benzylpenicilloyl PolylysineDoxylamine may decrease effectiveness of Benzylpenicilloyl Polylysine as a diagnostic agent.Approved
BetahistineThe therapeutic efficacy of Betahistine can be decreased when used in combination with Doxylamine.Approved
BrexpiprazoleDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Brexpiprazole.Approved
BrimonidineBrimonidine may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved
BromazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Bromazepam.Approved, Illicit
BrompheniramineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Brompheniramine.Approved
BrotizolamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Brotizolam.Approved, Withdrawn
BupivacaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Bupivacaine.Approved, Investigational
BuprenorphineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Buprenorphine.Approved, Illicit, Investigational, Vet Approved
BuspironeDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Buspirone.Approved, Investigational
ButabarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Butabarbital.Approved, Illicit
ButalbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Butalbital.Approved, Illicit
ButethalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Butethal.Approved, Illicit
ButorphanolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Butorphanol.Approved, Illicit, Vet Approved
CarbamazepineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Carbamazepine.Approved, Investigational
CarbinoxamineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Carbinoxamine.Approved
CarfentanilDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Carfentanil.Illicit, Vet Approved
CarisoprodolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Carisoprodol.Approved
CaroxazoneCaroxazone may increase the anticholinergic activities of Doxylamine.Withdrawn
CetirizineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Cetirizine.Approved
Chloral hydrateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chloral hydrate.Approved, Illicit, Vet Approved
ChlordiazepoxideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chlordiazepoxide.Approved, Illicit
ChlormezanoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chlormezanone.Approved, Withdrawn
ChloroprocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chloroprocaine.Approved
ChlorphenamineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chlorphenamine.Approved
ChlorphentermineChlorphentermine may decrease the sedative activities of Doxylamine.Illicit, Withdrawn
ChlorpromazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chlorpromazine.Approved, Vet Approved
ChlorprothixeneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chlorprothixene.Approved, Withdrawn
ChlorzoxazoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Chlorzoxazone.Approved
CinchocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Cinchocaine.Approved, Vet Approved
CitalopramThe risk or severity of adverse effects can be increased when Doxylamine is combined with Citalopram.Approved
ClemastineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clemastine.Approved
ClidiniumDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clidinium.Approved
ClobazamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clobazam.Approved, Illicit
ClomipramineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clomipramine.Approved, Vet Approved
ClonazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clonazepam.Approved, Illicit
ClonidineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clonidine.Approved
ClorazepateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clorazepate.Approved, Illicit
ClozapineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Clozapine.Approved
CocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Cocaine.Approved, Illicit
CodeineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Codeine.Approved, Illicit
CyclizineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Cyclizine.Approved
CyclobenzaprineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Cyclobenzaprine.Approved
CyproheptadineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Cyproheptadine.Approved
DantroleneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dantrolene.Approved
DapiprazoleDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dapiprazole.Approved
DapoxetineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Dapoxetine.Investigational
DeramciclaneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of deramciclane.Investigational
DesfluraneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Desflurane.Approved
DesipramineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Desipramine.Approved
DesloratadineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Desloratadine.Approved, Investigational
DesvenlafaxineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Desvenlafaxine.Approved
DexbrompheniramineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dexbrompheniramine.Approved
DexmedetomidineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dexmedetomidine.Approved, Vet Approved
DextroamphetamineDextroamphetamine may decrease the sedative activities of Doxylamine.Approved, Illicit
DextromoramideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dextromoramide.Experimental, Illicit
DextropropoxypheneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dextropropoxyphene.Approved, Illicit, Withdrawn
DezocineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dezocine.Approved
DiazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Diazepam.Approved, Illicit, Vet Approved
DiethylpropionDiethylpropion may decrease the sedative activities of Doxylamine.Approved, Illicit
DifenoxinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Difenoxin.Approved, Illicit
DihydrocodeineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dihydrocodeine.Approved, Illicit
DihydroetorphineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dihydroetorphine.Experimental, Illicit
DihydromorphineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dihydromorphine.Experimental, Illicit
DimenhydrinateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dimenhydrinate.Approved
DiphenhydramineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Diphenhydramine.Approved
DiphenoxylateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Diphenoxylate.Approved, Illicit
DoxepinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Doxepin.Approved
DronabinolDronabinol may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved, Illicit
DroperidolDroperidol may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved, Vet Approved
DrotebanolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Drotebanol.Experimental, Illicit
DuloxetineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Duloxetine.Approved
DyclonineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Dyclonine.Approved
EcgonineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ecgonine.Experimental, Illicit
EcopipamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ecopipam.Investigational
EfavirenzDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Efavirenz.Approved, Investigational
EltanoloneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pregnanolone.Investigational
EnfluraneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Enflurane.Approved, Vet Approved
EntacaponeDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Entacapone.Approved, Investigational
EscitalopramThe risk or severity of adverse effects can be increased when Doxylamine is combined with Escitalopram.Approved, Investigational
EstazolamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Estazolam.Approved, Illicit
EszopicloneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Eszopiclone.Approved
EthanolEthanol may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved
EthchlorvynolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ethchlorvynol.Approved, Illicit, Withdrawn
EthosuximideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ethosuximide.Approved
EthotoinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ethotoin.Approved
Ethyl carbamateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ethyl carbamate.Withdrawn
Ethyl loflazepateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ethyl loflazepate.Approved, Illicit
EthylmorphineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ethylmorphine.Approved, Illicit
EtidocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Etidocaine.Approved
EtifoxineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Etifoxine.Withdrawn
EtizolamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Etizolam.Approved
EtomidateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Etomidate.Approved
EtoperidoneThe risk or severity of adverse effects can be increased when Doxylamine is combined with Etoperidone.Approved
EtorphineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Etorphine.Illicit, Vet Approved
EzogabineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ezogabine.Approved
FelbamateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Felbamate.Approved
FencamfamineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fencamfamine.Approved, Illicit, Withdrawn
FentanylDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fentanyl.Approved, Illicit, Investigational, Vet Approved
FexofenadineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fexofenadine.Approved
FlibanserinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Flibanserin.Approved
FludiazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fludiazepam.Approved, Illicit
FlunarizineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Flunarizine.Approved
FlunitrazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Flunitrazepam.Approved, Illicit
FluoxetineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Fluoxetine.Approved, Vet Approved
FlupentixolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Flupentixol.Approved, Withdrawn
FluphenazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fluphenazine.Approved
FlurazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Flurazepam.Approved, Illicit
FluspirileneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fluspirilene.Approved
Fluticasone propionateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fluticasone Propionate.Approved
FluvoxamineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fluvoxamine.Approved, Investigational
FosphenytoinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fosphenytoin.Approved
FospropofolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Fospropofol.Approved, Illicit
FurazolidoneFurazolidone may increase the anticholinergic activities of Doxylamine.Approved, Vet Approved
GabapentinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Gabapentin.Approved, Investigational
Gabapentin EnacarbilDoxylamine may increase the central nervous system depressant (CNS depressant) activities of gabapentin enacarbil.Approved
Gamma Hydroxybutyric AcidDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Gamma Hydroxybutyric Acid.Approved, Illicit
GepironeDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Gepirone.Investigational
GlutethimideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Glutethimide.Approved, Illicit
GuanfacineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Guanfacine.Approved, Investigational
HalazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Halazepam.Approved, Illicit, Withdrawn
HaloperidolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Haloperidol.Approved
HalothaneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Halothane.Approved, Vet Approved
HeroinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Heroin.Approved, Illicit
HexobarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Hexobarbital.Approved
HyaluronidaseThe therapeutic efficacy of Hyaluronidase can be decreased when used in combination with Doxylamine.Approved, Investigational
HydracarbazineHydracarbazine may increase the anticholinergic activities of Doxylamine.Experimental
HydrocodoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Hydrocodone.Approved, Illicit
HydromorphoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Hydromorphone.Approved, Illicit
HydroxyamphetamineHydroxyamphetamine hydrobromide may decrease the sedative activities of Doxylamine.Approved
HydroxyzineHydroxyzine may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved
IloperidoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Iloperidone.Approved
ImipramineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Imipramine.Approved
IndalpineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Indalpine.Investigational, Withdrawn
IproclozideIproclozide may increase the anticholinergic activities of Doxylamine.Withdrawn
IproniazidIproniazid may increase the anticholinergic activities of Doxylamine.Withdrawn
IsocarboxazidIsocarboxazid may increase the anticholinergic activities of Doxylamine.Approved
IsofluraneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Isoflurane.Approved, Vet Approved
KetamineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ketamine.Approved, Vet Approved
KetazolamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ketazolam.Approved
KetobemidoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ketobemidone.Approved
LamotrigineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Lamotrigine.Approved, Investigational
LevetiracetamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Levetiracetam.Approved, Investigational
LevobupivacaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Levobupivacaine.Approved
LevocabastineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Levocabastine.Approved
LevocetirizineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Levocetirizine.Approved
LevodopaDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Levodopa.Approved
Levomethadyl AcetateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Levomethadyl Acetate.Approved
LevomilnacipranThe risk or severity of adverse effects can be increased when Doxylamine is combined with Levomilnacipran.Approved
LevorphanolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Levorphanol.Approved
LidocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Lidocaine.Approved, Vet Approved
LisdexamfetamineLisdexamfetamine may decrease the sedative activities of Doxylamine.Approved, Investigational
LithiumDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Lithium.Approved
LofentanilDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Lofentanil.Illicit
LoratadineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Loratadine.Approved
LorazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Lorazepam.Approved
LoxapineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Loxapine.Approved
LurasidoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Lurasidone.Approved
Magnesium SulfateMagnesium Sulfate may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved, Vet Approved
MaprotilineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Maprotiline.Approved
MebanazineMebanazine may increase the anticholinergic activities of Doxylamine.Withdrawn
MeclizineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Meclizine.Approved
MelatoninDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Melatonin.Approved, Nutraceutical, Vet Approved
MelperoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Melperone.Approved
MephedroneMephedrone may decrease the sedative activities of Doxylamine.Investigational
MephentermineMephentermine may decrease the sedative activities of Doxylamine.Approved
MepivacaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Mepivacaine.Approved, Vet Approved
MeprobamateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Meprobamate.Approved, Illicit
MesoridazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Mesoridazine.Approved
MetaxaloneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Metaxalone.Approved
MethadoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methadone.Approved
Methadyl AcetateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methadyl Acetate.Approved, Illicit
MethamphetamineMethamphetamine may decrease the sedative activities of Doxylamine.Approved, Illicit
MethapyrileneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methapyrilene.Withdrawn
MethaqualoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methaqualone.Illicit, Withdrawn
MethocarbamolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methocarbamol.Approved, Vet Approved
MethohexitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methohexital.Approved
MethotrimeprazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methotrimeprazine.Approved
MethoxyfluraneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methoxyflurane.Approved, Vet Approved
MethsuximideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methsuximide.Approved
MethylecgonineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of ECGONINE METHYL ESTER.Experimental
Methylene blueMethylene blue may increase the anticholinergic activities of Doxylamine.Investigational
MethylphenobarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Methylphenobarbital.Approved
MetyrosineDoxylamine may increase the sedative activities of Metyrosine.Approved
MidazolamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Midazolam.Approved, Illicit
MilnacipranThe risk or severity of adverse effects can be increased when Doxylamine is combined with Milnacipran.Approved
MinaprineMinaprine may increase the anticholinergic activities of Doxylamine.Approved
MinocyclineMinocycline may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved, Investigational
MirtazapineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Mirtazapine.Approved
MMDAMMDA may decrease the sedative activities of Doxylamine.Experimental, Illicit
MoclobemideMoclobemide may increase the anticholinergic activities of Doxylamine.Approved
MolindoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Molindone.Approved
MorphineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Morphine.Approved, Investigational
NabiloneNabilone may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved, Investigational
NalbuphineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Nalbuphine.Approved
NefazodoneThe risk or severity of adverse effects can be increased when Doxylamine is combined with Nefazodone.Approved, Withdrawn
NialamideNialamide may increase the anticholinergic activities of Doxylamine.Withdrawn
NitrazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Nitrazepam.Approved
Nitrous oxideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Nitrous oxide.Approved, Vet Approved
NorfluraneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of 1,1,1,2 Tetrafluoroethane.Investigational
NormethadoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Normethadone.Approved, Illicit
NortriptylineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Nortriptyline.Approved
OctamoxinOctamoxin may increase the anticholinergic activities of Doxylamine.Withdrawn
OlanzapineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Olanzapine.Approved, Investigational
OlopatadineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Olopatadine.Approved
OndansetronDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ondansetron.Approved
OpiumDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Opium.Approved, Illicit
OrphenadrineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Orphenadrine.Approved
OsanetantDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Osanetant.Investigational
OxazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Oxazepam.Approved
OxethazaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Oxetacaine.Investigational
OxprenololDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Oxprenolol.Approved
OxybuprocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Oxybuprocaine.Approved
OxycodoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Oxycodone.Approved, Illicit, Investigational
OxymorphoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Oxymorphone.Approved, Investigational, Vet Approved
PaliperidoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Paliperidone.Approved
ParaldehydeDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Paraldehyde.Approved
PargylinePargyline may increase the anticholinergic activities of Doxylamine.Approved
ParoxetineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Paroxetine.Approved, Investigational
PentazocineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pentazocine.Approved, Vet Approved
PentobarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pentobarbital.Approved, Vet Approved
PerampanelPerampanel may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved
PerazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Perazine.Investigational
PerospironeDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Perospirone.Approved
PerphenazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Perphenazine.Approved
PethidineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pethidine.Approved
PhenelzinePhenelzine may increase the anticholinergic activities of Doxylamine.Approved
PheniprazinePheniprazine may increase the anticholinergic activities of Doxylamine.Withdrawn
PhenobarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Phenobarbital.Approved
PhenoxypropazinePhenoxypropazine may increase the anticholinergic activities of Doxylamine.Withdrawn
PhenterminePhentermine may decrease the sedative activities of Doxylamine.Approved, Illicit
PhenytoinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Phenytoin.Approved, Vet Approved
PimozideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pimozide.Approved
PipamperoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pipamperone.Approved
PipotiazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pipotiazine.Approved
PiritramideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Piritramide.Investigational
PirlindolePirlindole may increase the anticholinergic activities of Doxylamine.Approved
PivhydrazinePivhydrazine may increase the anticholinergic activities of Doxylamine.Withdrawn
PomalidomideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pomalidomide.Approved
PramipexoleDoxylamine may increase the sedative activities of Pramipexole.Approved, Investigational
PramocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pramocaine.Approved
PrazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Prazepam.Approved, Illicit
PregabalinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Pregabalin.Approved, Illicit, Investigational
PrilocaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Prilocaine.Approved
PrimidoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Primidone.Approved, Vet Approved
ProcaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Procaine.Approved, Investigational, Vet Approved
ProchlorperazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Prochlorperazine.Approved, Vet Approved
PromazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Promazine.Approved, Vet Approved
PromethazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Promethazine.Approved
ProparacaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Proparacaine.Approved, Vet Approved
PropofolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Propofol.Approved, Investigational, Vet Approved
PropoxycaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Propoxycaine.Approved
ProtriptylineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Protriptyline.Approved
PseudoephedrinePseudoephedrine may decrease the sedative activities of Doxylamine.Approved
QuazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Quazepam.Approved, Illicit
QuetiapineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Quetiapine.Approved
RacloprideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Raclopride.Investigational
RamelteonDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ramelteon.Approved, Investigational
RasagilineRasagiline may increase the anticholinergic activities of Doxylamine.Approved
RemifentanilDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Remifentanil.Approved
RemoxiprideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Remoxipride.Approved, Withdrawn
ReserpineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Reserpine.Approved
RisperidoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Risperidone.Approved, Investigational
RitanserinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ritanserin.Investigational
RitobegronRitobegron may decrease the sedative activities of Doxylamine.Investigational
RopiniroleDoxylamine may increase the sedative activities of Ropinirole.Approved, Investigational
RopivacaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ropivacaine.Approved
RotigotineDoxylamine may increase the sedative activities of Rotigotine.Approved
RufinamideThe risk or severity of adverse effects can be increased when Rufinamide is combined with Doxylamine.Approved
SafrazineSafrazine may increase the anticholinergic activities of Doxylamine.Withdrawn
ScopolamineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Scopolamine.Approved
SecobarbitalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Secobarbital.Approved, Vet Approved
SelegilineSelegiline may increase the anticholinergic activities of Doxylamine.Approved, Investigational, Vet Approved
SepranoloneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Uc1010.Investigational
SertindoleDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Sertindole.Approved, Withdrawn
SertralineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Sertraline.Approved
SevofluraneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Sevoflurane.Approved, Vet Approved
Sodium oxybateSodium oxybate may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved
StiripentolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Stiripentol.Approved
SufentanilDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Sufentanil.Approved, Investigational
SulpirideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Sulpiride.Approved
SuvorexantDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Suvorexant.Approved
TandospironeDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tandospirone.Investigational
TapentadolTapentadol may increase the central nervous system depressant (CNS depressant) activities of Doxylamine.Approved
TasimelteonDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tasimelteon.Approved
TemazepamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Temazepam.Approved
TetrabenazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tetrabenazine.Approved
TetracaineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tetracaine.Approved, Vet Approved
TetrodotoxinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tetrodotoxin.Investigational
ThalidomideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Thalidomide.Approved, Investigational, Withdrawn
ThiamylalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Thiamylal.Approved, Vet Approved
ThiopentalDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Thiopental.Approved, Vet Approved
ThioridazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Thioridazine.Withdrawn
ThiothixeneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Thiothixene.Approved
TiagabineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tiagabine.Approved
TiaprideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tiapride.Approved, Investigational
TizanidineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tizanidine.Approved
TolcaponeDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tolcapone.Approved, Withdrawn
ToloxatoneToloxatone may increase the anticholinergic activities of Doxylamine.Approved
TopiramateDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Topiramate.Approved
TramadolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Tramadol.Approved, Investigational
Trans-2-PhenylcyclopropylamineTrans-2-Phenylcyclopropylamine may increase the anticholinergic activities of Doxylamine.Experimental
TranylcypromineTranylcypromine may increase the anticholinergic activities of Doxylamine.Approved
TrazodoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Trazodone.Approved, Investigational
TriazolamDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Triazolam.Approved
TrifluoperazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Trifluoperazine.Approved
TriflupromazineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Triflupromazine.Approved, Vet Approved
TrimipramineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Trimipramine.Approved
TriprolidineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Triprolidine.Approved
Valproic AcidDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Valproic Acid.Approved, Investigational
VenlafaxineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Venlafaxine.Approved
VigabatrinDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Vigabatrin.Approved
VortioxetineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Vortioxetine.Approved
ZaleplonDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Zaleplon.Approved, Illicit, Investigational
ZiconotideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ziconotide.Approved
ZimelidineThe risk or severity of adverse effects can be increased when Doxylamine is combined with Zimelidine.Withdrawn
ZiprasidoneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Ziprasidone.Approved
ZolpidemDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Zolpidem.Approved
ZonisamideDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Zonisamide.Approved, Investigational
ZopicloneDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Zopiclone.Approved
ZotepineDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Zotepine.Approved
ZuclopenthixolDoxylamine may increase the central nervous system depressant (CNS depressant) activities of Zuclopenthixol.Approved, Investigational
Food InteractionsNot Available
References
Synthesis ReferenceNot Available
General ReferencesNot Available
External Links
ATC CodesR06AA59 — Doxylamine, combinationsR06AA09 — Doxylamine
AHFS Codes
  • 04:04.04
PDB EntriesNot Available
FDA labelNot Available
MSDSDownload (74 KB)
Clinical Trials
Clinical Trials
PhaseStatusPurposeConditionsCount
1CompletedNot AvailableAllergic Rhinitis (AR) / Upper Respiratory Infections1
3CompletedPreventionHyperemesis Gravidarum / Pregnancy1
3CompletedTreatmentNausea and Vomiting of Pregnancy1
4RecruitingTreatmentMorning Sickness1
Pharmacoeconomics
ManufacturersNot Available
Packagers
Dosage forms
FormRouteStrength
Capsule, gelatin coatedOral
Kit
Tablet, effervescentOral
Powder, for solutionOral
Capsule; kitOral
CapsuleOral
KitOral
Tablet, delayed releaseOral
SolutionOral
TabletOral25 mg/1
SyrupOral
Tablet, coatedOral
TabletOral
LiquidOral
Capsule, liquid filledOral
SyrupOral9.75 mg/5mL
Tablet, film coatedOral
Kit; tabletOral
TabletOral25 mg
Prices
Unit descriptionCostUnit
Doxylamine succinate powder1.5USD g
Unisom sleep aid tablet0.34USD tablet
Sleep aid 25 mg tablet0.15USD tablet
DrugBank does not sell nor buy drugs. Pricing information is supplied for informational purposes only.
Patents
Patent NumberPediatric ExtensionApprovedExpires (estimated)
US6340695 No2001-06-212021-06-21Us
US7560122 No1999-01-252019-01-25Us
Properties
StateLiquid
Experimental Properties
PropertyValueSource
melting point (°C)< 25 °CPhysProp
boiling point (°C)139 °C at 5.00E-01 mm HgPhysProp
water solubility1 g/ml (succinate salt)Not Available
logP2.5Not Available
Predicted Properties
PropertyValueSource
Water Solubility0.541 mg/mLALOGPS
logP2.9ALOGPS
logP2.96ChemAxon
logS-2.7ALOGPS
pKa (Strongest Basic)8.87ChemAxon
Physiological Charge1ChemAxon
Hydrogen Acceptor Count3ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area25.36 Å2ChemAxon
Rotatable Bond Count6ChemAxon
Refractivity82.24 m3·mol-1ChemAxon
Polarizability31.09 Å3ChemAxon
Number of Rings2ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleNoChemAxon
Predicted ADMET features
PropertyValueProbability
Human Intestinal Absorption+0.9505
Blood Brain Barrier+0.9491
Caco-2 permeable+0.746
P-glycoprotein substrateSubstrate0.7449
P-glycoprotein inhibitor INon-inhibitor0.5123
P-glycoprotein inhibitor IINon-inhibitor0.8383
Renal organic cation transporterInhibitor0.7507
CYP450 2C9 substrateNon-substrate0.8153
CYP450 2D6 substrateNon-substrate0.5432
CYP450 3A4 substrateSubstrate0.6801
CYP450 1A2 substrateNon-inhibitor0.9092
CYP450 2C9 inhibitorNon-inhibitor0.8957
CYP450 2D6 inhibitorInhibitor0.8361
CYP450 2C19 inhibitorNon-inhibitor0.8764
CYP450 3A4 inhibitorNon-inhibitor0.6894
CYP450 inhibitory promiscuityLow CYP Inhibitory Promiscuity0.736
Ames testNon AMES toxic0.9133
CarcinogenicityNon-carcinogens0.9183
BiodegradationNot ready biodegradable1.0
Rat acute toxicity2.9218 LD50, mol/kg Not applicable
hERG inhibition (predictor I)Weak inhibitor0.8765
hERG inhibition (predictor II)Inhibitor0.5398
ADMET data is predicted using admetSAR, a free tool for evaluating chemical ADMET properties. (23092397 )
Spectra
Mass Spec (NIST)Not Available
Spectra
Spectrum TypeDescriptionSplash Key
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 10V, Positive (Annotated)splash10-0040-0956300000-af11cf85a674e7db3735View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 25V, Positive (Annotated)splash10-001i-0910000000-b3cb895f045d519f2bf3View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 40V, Positive (Annotated)splash10-00kb-5597500000-8495062a84b32e776f33View in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-QFT , positivesplash10-001i-1920000000-07b98b36c7ef5d9ad048View in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-QFT , positivesplash10-001i-0900000000-1ae1143763892a7aac22View in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-QFT , positivesplash10-001i-0900000000-460d58a5bb6a5eb5f55bView in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-QFT , positivesplash10-0159-0900000000-34dc5c06413efae437daView in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-QFT , positivesplash10-014i-0900000000-8a5f15b863b7129c1288View in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-QFT , positivesplash10-014i-0900000000-072ffba5139b7324d27aView in MoNA
LC-MS/MSLC-MS/MS Spectrum - , positivesplash10-00lr-0900000000-fdf3fc57eff19bfe8fd8View in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-qTof , PositiveNot Available
MSMass Spectrum (Electron Ionization)splash10-0ab9-9200000000-5a71de62862f9881c2a1View in MoNA
1D NMR1H NMR SpectrumNot Available
2D NMR[1H,13C] 2D NMR SpectrumNot Available
Taxonomy
DescriptionThis compound belongs to the class of organic compounds known as benzylethers. These are aromatic ethers with the general formula ROCR' (R = alkyl, aryl; R'=benzene).
KingdomOrganic compounds
Super ClassBenzenoids
ClassBenzene and substituted derivatives
Sub ClassBenzylethers
Direct ParentBenzylethers
Alternative ParentsPyridines and derivatives / Heteroaromatic compounds / Trialkylamines / Dialkyl ethers / Azacyclic compounds / Organopnictogen compounds / Hydrocarbon derivatives
SubstituentsBenzylether / Pyridine / Heteroaromatic compound / Tertiary amine / Tertiary aliphatic amine / Azacycle / Organoheterocyclic compound / Ether / Dialkyl ether / Amine
Molecular FrameworkAromatic heteromonocyclic compounds
External Descriptorstertiary amine, pyridines (CHEBI:51380 )

Targets

Details
1. Histamine H1 receptor
Kind
Protein
Organism
Human
Pharmacological action
yes
Actions
antagonist
General Function:
Histamine receptor activity
Specific Function:
In peripheral tissues, the H1 subclass of histamine receptors mediates the contraction of smooth muscles, increase in capillary permeability due to contraction of terminal venules, and catecholamine release from adrenal medulla, as well as mediating neurotransmission in the central nervous system.
Gene Name:
HRH1
Uniprot ID:
P35367
Molecular Weight:
55783.61 Da
References
  1. Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. [PubMed:17139284 ]
  2. Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. [PubMed:17016423 ]
  3. Chen X, Ji ZL, Chen YZ: TTD: Therapeutic Target Database. Nucleic Acids Res. 2002 Jan 1;30(1):412-5. [PubMed:11752352 ]
Details
2. Muscarinic acetylcholine receptor M1
Kind
Protein
Organism
Human
Pharmacological action
unknown
Actions
antagonist
General Function:
Phosphatidylinositol phospholipase c activity
Specific Function:
The muscarinic acetylcholine receptor mediates various cellular responses, including inhibition of adenylate cyclase, breakdown of phosphoinositides and modulation of potassium channels through the action of G proteins. Primary transducing effect is Pi turnover.
Gene Name:
CHRM1
Uniprot ID:
P11229
Molecular Weight:
51420.375 Da
References
  1. Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. [PubMed:17139284 ]
  2. Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. [PubMed:17016423 ]
Details
3. Nuclear receptor subfamily 1 group I member 3
Kind
Protein
Organism
Human
Pharmacological action
unknown
General Function:
Zinc ion binding
Specific Function:
Binds and transactivates the retinoic acid response elements that control expression of the retinoic acid receptor beta 2 and alcohol dehydrogenase 3 genes. Transactivates both the phenobarbital responsive element module of the human CYP2B6 gene and the CYP3A4 xenobiotic response element.
Gene Name:
NR1I3
Uniprot ID:
Q14994
Molecular Weight:
39942.145 Da
References
  1. Dring AM, Anderson LE, Qamar S, Stoner MA: Rational quantitative structure-activity relationship (RQSAR) screen for PXR and CAR isoform-specific nuclear receptor ligands. Chem Biol Interact. 2010 Dec 5;188(3):512-25. doi: 10.1016/j.cbi.2010.09.018. Epub 2010 Oct 20. [PubMed:20869355 ]

Enzymes

Details
1. CYP2B protein
Kind
Protein
Organism
Human
Pharmacological action
unknown
Actions
inducer
General Function:
Oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen
Specific Function:
Not Available
Gene Name:
CYP2B
Uniprot ID:
Q14097
Molecular Weight:
43147.81 Da
References
  1. Bookstaff RC, Murphy VA, Skare JA, Minnema D, Sanzgiri U, Parkinson A: Effects of doxylamine succinate on thyroid hormone balance and enzyme induction in mice. Toxicol Appl Pharmacol. 1996 Dec;141(2):584-94. [PubMed:8975784 ]
Drug created on June 13, 2005 07:24 / Updated on July 22, 2017 18:04